EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C47H50O26 |
| Net Charge | 0 |
| Average Mass | 1030.891 |
| Monoisotopic Mass | 1030.25903 |
| SMILES | CC(=O)OC[C@H]1O[C@@H](Oc2cc(OC(C)=O)c3c(=O)c(O[C@@H]4O[C@H](COC(C)=O)[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@H]4OC(C)=O)c(-c4ccc(OC(C)=O)cc4)oc3c2)[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C47H50O26/c1-19(48)59-17-34-39(63-23(5)52)42(65-25(7)54)44(67-27(9)56)46(71-34)69-31-15-32(62-22(4)51)36-33(16-31)70-38(29-11-13-30(14-12-29)61-21(3)50)41(37(36)58)73-47-45(68-28(10)57)43(66-26(8)55)40(64-24(6)53)35(72-47)18-60-20(2)49/h11-16,34-35,39-40,42-47H,17-18H2,1-10H3/t34-,35-,39-,40-,42+,43+,44-,45-,46-,47+/m1/s1 |
| InChIKey | NLVNWKWBXDAKIC-GHNQEIAISA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Delphinium staphisagria (ncbitaxon:104301) | aerial part (BTO:0001658) | PubMed (21466157) | 80% ethanolic extract of chopped fresh plant |
| Roles Classification |
|---|
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. trypanocidal drug A drug used to treat or prevent infections caused by protozoal organisms belonging to the suborder Trypanosomatida. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| Application: | trypanocidal drug A drug used to treat or prevent infections caused by protozoal organisms belonging to the suborder Trypanosomatida. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| paeonoside decaacetate (CHEBI:67930) has functional parent kaempferol 3,7-di-O-β-D-glucoside (CHEBI:133224) |
| paeonoside decaacetate (CHEBI:67930) has role metabolite (CHEBI:25212) |
| paeonoside decaacetate (CHEBI:67930) has role plant metabolite (CHEBI:76924) |
| paeonoside decaacetate (CHEBI:67930) has role trypanocidal drug (CHEBI:36335) |
| paeonoside decaacetate (CHEBI:67930) is a acetate ester (CHEBI:47622) |
| paeonoside decaacetate (CHEBI:67930) is a kaempferol O-glucoside (CHEBI:64634) |
| paeonoside decaacetate (CHEBI:67930) is a β-D-glucoside (CHEBI:22798) |
| IUPAC Name |
|---|
| 4-{5-(acetyloxy)-4-oxo-3,7-bis[(2,3,4,6-tetra-O-acetyl-β-D-glucopyranosyl)oxy]-4H-chromen-2-yl}phenyl acetate |
| Synonym | Source |
|---|---|
| kaempferol-3,7-di-O-β-D-glucopyranoside decacetate | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:23277590 | Reaxys |
| Citations |
|---|