EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H34O5 |
| Net Charge | 0 |
| Average Mass | 402.531 |
| Monoisotopic Mass | 402.24062 |
| SMILES | COC1=CC(=O)[C@]2(C/C=C(\C)CC/C=C(\C)CCC=C(C)C)O[C@@H]2[C@@H]1OC(C)=O |
| InChI | InChI=1S/C24H34O5/c1-16(2)9-7-10-17(3)11-8-12-18(4)13-14-24-21(26)15-20(27-6)22(23(24)29-24)28-19(5)25/h9,11,13,15,22-23H,7-8,10,12,14H2,1-6H3/b17-11+,18-13+/t22-,23-,24+/m1/s1 |
| InChIKey | NHRZKPRMGXJSET-YVCJEVKHSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Aspergillus niger ATCC 1015 (ncbitaxon:380704) | - | PubMed (24684908) | Strain: KB1001 |
| Roles Classification |
|---|
| Biological Roles: | Aspergillus metabolite Any fungal metabolite produced during a metabolic reaction in the mould, Aspergillus . metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| yanuthone X1 (CHEBI:133095) has functional parent yanuthone X2 (CHEBI:133037) |
| yanuthone X1 (CHEBI:133095) has role Aspergillus metabolite (CHEBI:76956) |
| yanuthone X1 (CHEBI:133095) is a acetate ester (CHEBI:47622) |
| yanuthone X1 (CHEBI:133095) is a class II yanuthone (CHEBI:133081) |
| yanuthone X1 (CHEBI:133095) is a enol ether (CHEBI:47985) |
| IUPAC Name |
|---|
| (1R,2S,6R)-3-methoxy-5-oxo-6-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trien-1-yl]-7-oxabicyclo[4.1.0]hept-3-en-2-yl acetate |
| Citations |
|---|