EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H35FN3O2 |
| Net Charge | +1 |
| Average Mass | 428.572 |
| Monoisotopic Mass | 428.27078 |
| SMILES | CC(C)COc1ccc(CNC(=O)N(Cc2ccc(F)cc2)C2CC[NH+](C)CC2)cc1 |
| InChI | InChI=1S/C25H34FN3O2/c1-19(2)18-31-24-10-6-20(7-11-24)16-27-25(30)29(23-12-14-28(3)15-13-23)17-21-4-8-22(26)9-5-21/h4-11,19,23H,12-18H2,1-3H3,(H,27,30)/p+1 |
| InChIKey | RKEWSXXUOLRFBX-UHFFFAOYSA-O |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| pimavanserin(1+) (CHEBI:133020) is a piperidinium ion (CHEBI:48633) |
| pimavanserin(1+) (CHEBI:133020) is conjugate acid of pimavanserin (CHEBI:133017) |
| Incoming Relation(s) |
| pimavanserin tartrate (CHEBI:133014) has part pimavanserin(1+) (CHEBI:133020) |
| pimavanserin (CHEBI:133017) is conjugate base of pimavanserin(1+) (CHEBI:133020) |
| IUPAC Name |
|---|
| 4-{[(4-fluorophenyl)methyl]({[4-(2-methylpropoxy)phenyl]methyl}carbamoyl)amino}-1-methylpiperidin-1-ium |
| Synonym | Source |
|---|---|
| pimavanserin cation | ChEBI |