EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | 2C25H34FN3O2.C4H6O6 |
| Net Charge | 0 |
| Average Mass | 1005.214 |
| Monoisotopic Mass | 1004.54345 |
| SMILES | CC(C)COc1ccc(CNC(=O)N(Cc2ccc(F)cc2)C2CCN(C)CC2)cc1.CC(C)COc1ccc(CNC(=O)N(Cc2ccc(F)cc2)C2CCN(C)CC2)cc1.O=C(O)[C@H](O)[C@@H](O)C(=O)O |
| InChI | InChI=1S/2C25H34FN3O2.C4H6O6/c2*1-19(2)18-31-24-10-6-20(7-11-24)16-27-25(30)29(23-12-14-28(3)15-13-23)17-21-4-8-22(26)9-5-21;5-1(3(7)8)2(6)4(9)10/h2*4-11,19,23H,12-18H2,1-3H3,(H,27,30);1-2,5-6H,(H,7,8)(H,9,10)/t;;1-,2-/m..1/s1 |
| InChIKey | RGSULKHNAKTFIZ-CEAXSRTFSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | 5-hydroxytryptamine 2A receptor inverse agonist An inverse agonist that binds to the same receptor as a 5-hydroxytryptamine 2A receptor agonist, but which induces a pharmacological response opposite to that agonist. serotonergic antagonist Drugs that bind to but do not activate serotonin receptors, thereby blocking the actions of serotonin or serotonergic agonists. |
| Applications: | antipsychotic agent Antipsychotic drugs are agents that control agitated psychotic behaviour, alleviate acute psychotic states, reduce psychotic symptoms, and exert a quieting effect. serotonergic antagonist Drugs that bind to but do not activate serotonin receptors, thereby blocking the actions of serotonin or serotonergic agonists. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| pimavanserin tartrate (CHEBI:133014) has part pimavanserin(1+) (CHEBI:133020) |
| pimavanserin tartrate (CHEBI:133014) has role 5-hydroxytryptamine 2A receptor inverse agonist (CHEBI:133016) |
| pimavanserin tartrate (CHEBI:133014) has role antipsychotic agent (CHEBI:35476) |
| pimavanserin tartrate (CHEBI:133014) has role serotonergic antagonist (CHEBI:48279) |
| pimavanserin tartrate (CHEBI:133014) is a tartrate salt (CHEBI:50562) |
| IUPAC Names |
|---|
| bis(4-{[(4-fluorophenyl)methyl]({[4-(2-methylpropoxy)phenyl]methyl}carbamoyl)amino}-1-methylpiperidin-1-ium) (2R,3R)-2,3-dihydroxybutanedioate |
| bis{N-[(4-fluorophenyl)methyl]-N-(1-methylpiperidin-4-yl)-N'-{[4-(2-methylpropoxy)phenyl]methyl}urea} (2R,3R)-2,3-dihydroxybutanedioate |
| Synonyms | Source |
|---|---|
| ACP 103 | ChemIDplus |
| ACP-103 | ChemIDplus |
| Bis(1-(4-Fluorobenzyl)-1-(1-methylpiperidin-4-yl)-3-(4-(2-methylpropoxy)benzyl)urea) (2R,3R)-2,3-dihydroxybutanedioate | ChemIDplus |
| pimavanserin hemitartrate | ChEBI |
| Brand Name | Source |
|---|---|
| Nuplazid | KEGG DRUG |
| Manual Xrefs | Databases |
|---|---|
| D08969 | KEGG DRUG |
| NZ541146 | Patent |
| Pimavanserin | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:10410569 | Reaxys |
| CAS:706782-28-7 | ChemIDplus |
| CAS:706782-28-7 | KEGG DRUG |
| Citations |
|---|