EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H34FN3O2 |
| Net Charge | 0 |
| Average Mass | 427.564 |
| Monoisotopic Mass | 427.26351 |
| SMILES | CC(C)COc1ccc(CNC(=O)N(Cc2ccc(F)cc2)C2CCN(C)CC2)cc1 |
| InChI | InChI=1S/C25H34FN3O2/c1-19(2)18-31-24-10-6-20(7-11-24)16-27-25(30)29(23-12-14-28(3)15-13-23)17-21-4-8-22(26)9-5-21/h4-11,19,23H,12-18H2,1-3H3,(H,27,30) |
| InChIKey | RKEWSXXUOLRFBX-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | serotonergic antagonist Drugs that bind to but do not activate serotonin receptors, thereby blocking the actions of serotonin or serotonergic agonists. 5-hydroxytryptamine 2A receptor inverse agonist An inverse agonist that binds to the same receptor as a 5-hydroxytryptamine 2A receptor agonist, but which induces a pharmacological response opposite to that agonist. |
| Applications: | serotonergic antagonist Drugs that bind to but do not activate serotonin receptors, thereby blocking the actions of serotonin or serotonergic agonists. antipsychotic agent Antipsychotic drugs are agents that control agitated psychotic behaviour, alleviate acute psychotic states, reduce psychotic symptoms, and exert a quieting effect. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| pimavanserin (CHEBI:133017) has role 5-hydroxytryptamine 2A receptor inverse agonist (CHEBI:133016) |
| pimavanserin (CHEBI:133017) has role antipsychotic agent (CHEBI:35476) |
| pimavanserin (CHEBI:133017) has role serotonergic antagonist (CHEBI:48279) |
| pimavanserin (CHEBI:133017) is a aromatic ether (CHEBI:35618) |
| pimavanserin (CHEBI:133017) is a monofluorobenzenes (CHEBI:83575) |
| pimavanserin (CHEBI:133017) is a piperidines (CHEBI:26151) |
| pimavanserin (CHEBI:133017) is a tertiary amino compound (CHEBI:50996) |
| pimavanserin (CHEBI:133017) is a ureas (CHEBI:47857) |
| pimavanserin (CHEBI:133017) is conjugate base of pimavanserin(1+) (CHEBI:133020) |
| Incoming Relation(s) |
| pimavanserin(1+) (CHEBI:133020) is conjugate acid of pimavanserin (CHEBI:133017) |
| IUPAC Name |
|---|
| N-[(4-fluorophenyl)methyl]-N-(1-methylpiperidin-4-yl)-N'-{[4-(2-methylpropoxy)phenyl]methyl}urea |
| INN | Source |
|---|---|
| pimavanserin | ChemIDplus |
| Synonym | Source |
|---|---|
| N-(4-Fluorophenylmethyl)-N-(1-methylpiperidin-4-yl)-N'-(4-(2-methylpropyloxy)phenylmethyl) carbamide | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| 5142 | DrugCentral |
| CA2652300 | Patent |
| Pimavanserin | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:10386699 | Reaxys |
| CAS:706779-91-1 | ChemIDplus |
| Citations |
|---|