EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H34FN3O2 |
| Net Charge | 0 |
| Average Mass | 427.564 |
| Monoisotopic Mass | 427.26351 |
| SMILES | CC(C)COc1ccc(CNC(=O)N(Cc2ccc(F)cc2)C2CCN(C)CC2)cc1 |
| InChI | InChI=1S/C25H34FN3O2/c1-19(2)18-31-24-10-6-20(7-11-24)16-27-25(30)29(23-12-14-28(3)15-13-23)17-21-4-8-22(26)9-5-21/h4-11,19,23H,12-18H2,1-3H3,(H,27,30) |
| InChIKey | RKEWSXXUOLRFBX-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | 5-hydroxytryptamine 2A receptor inverse agonist An inverse agonist that binds to the same receptor as a 5-hydroxytryptamine 2A receptor agonist, but which induces a pharmacological response opposite to that agonist. serotonergic antagonist Drugs that bind to but do not activate serotonin receptors, thereby blocking the actions of serotonin or serotonergic agonists. |
| Applications: | antipsychotic agent Antipsychotic drugs are agents that control agitated psychotic behaviour, alleviate acute psychotic states, reduce psychotic symptoms, and exert a quieting effect. serotonergic antagonist Drugs that bind to but do not activate serotonin receptors, thereby blocking the actions of serotonin or serotonergic agonists. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| pimavanserin (CHEBI:133017) has role 5-hydroxytryptamine 2A receptor inverse agonist (CHEBI:133016) |
| pimavanserin (CHEBI:133017) has role antipsychotic agent (CHEBI:35476) |
| pimavanserin (CHEBI:133017) has role serotonergic antagonist (CHEBI:48279) |
| pimavanserin (CHEBI:133017) is a aromatic ether (CHEBI:35618) |
| pimavanserin (CHEBI:133017) is a monofluorobenzenes (CHEBI:83575) |
| pimavanserin (CHEBI:133017) is a piperidines (CHEBI:26151) |
| pimavanserin (CHEBI:133017) is a tertiary amino compound (CHEBI:50996) |
| pimavanserin (CHEBI:133017) is a ureas (CHEBI:47857) |
| pimavanserin (CHEBI:133017) is conjugate base of pimavanserin(1+) (CHEBI:133020) |
| Incoming Relation(s) |
| pimavanserin(1+) (CHEBI:133020) is conjugate acid of pimavanserin (CHEBI:133017) |
| IUPAC Name |
|---|
| N-[(4-fluorophenyl)methyl]-N-(1-methylpiperidin-4-yl)-N'-{[4-(2-methylpropoxy)phenyl]methyl}urea |
| INN | Source |
|---|---|
| pimavanserin | ChemIDplus |
| Synonym | Source |
|---|---|
| N-(4-Fluorophenylmethyl)-N-(1-methylpiperidin-4-yl)-N'-(4-(2-methylpropyloxy)phenylmethyl) carbamide | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| Pimavanserin | Wikipedia |
| CA2652300 | Patent |
| 5142 | DrugCentral |
| Registry Numbers | Sources |
|---|---|
| Reaxys:10386699 | Reaxys |
| CAS:706779-91-1 | ChemIDplus |
| Citations |
|---|