EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H23Cl2N3O |
| Net Charge | +2 |
| Average Mass | 380.319 |
| Monoisotopic Mass | 379.12072 |
| SMILES | COc1ccc2nc3cc(Cl)ccc3c([NH2+]CCC[NH2+]CCCl)c2c1 |
| InChI | InChI=1S/C19H21Cl2N3O/c1-25-14-4-6-17-16(12-14)19(23-9-2-8-22-10-7-20)15-5-3-13(21)11-18(15)24-17/h3-6,11-12,22H,2,7-10H2,1H3,(H,23,24)/p+2 |
| InChIKey | OAPNFEMIOBGOHM-UHFFFAOYSA-P |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| acridine half-mustard(2+) (CHEBI:132981) is a ammonium ion derivative (CHEBI:35274) |
| acridine half-mustard(2+) (CHEBI:132981) is conjugate acid of acridine half-mustard (CHEBI:132980) |
| Incoming Relation(s) |
| acridine half-mustard dihydrochloride (CHEBI:132982) has part acridine half-mustard(2+) (CHEBI:132981) |
| acridine half-mustard (CHEBI:132980) is conjugate base of acridine half-mustard(2+) (CHEBI:132981) |
| IUPAC Name |
|---|
| N-(2-chloroethyl)-N'-(6-chloro-2-methoxyacridin-9-yl)propane-1,3-bis(aminium) |
| Synonyms | Source |
|---|---|
| 6-chloro-9-[3-(2-chloroethylamino)propylamino]-2-methoxyacridine(2+) | ChEBI |
| ICR 191(2+) | ChEBI |
| ICR-191(2+) | ChEBI |