EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H21Cl2N3O.2HCl |
| Net Charge | 0 |
| Average Mass | 451.225 |
| Monoisotopic Mass | 449.05952 |
| SMILES | COc1ccc2nc3cc(Cl)ccc3c(NCCCNCCCl)c2c1.Cl.Cl |
| InChI | InChI=1S/C19H21Cl2N3O.2ClH/c1-25-14-4-6-17-16(12-14)19(23-9-2-8-22-10-7-20)15-5-3-13(21)11-18(15)24-17;;/h3-6,11-12,22H,2,7-10H2,1H3,(H,23,24);2*1H |
| InChIKey | LMEMIKWTNPWYMI-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | mutagen An agent that increases the frequency of mutations above the normal background level, usually by interacting directly with DNA and causing it damage, including base substitution. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| acridine half-mustard dihydrochloride (CHEBI:132982) has part acridine half-mustard(2+) (CHEBI:132981) |
| acridine half-mustard dihydrochloride (CHEBI:132982) has role mutagen (CHEBI:25435) |
| acridine half-mustard dihydrochloride (CHEBI:132982) is a hydrochloride (CHEBI:36807) |
| IUPAC Name |
|---|
| N-(2-chloroethyl)-N'-(6-chloro-2-methoxyacridin-9-yl)propane-1,3-diamine dihydrochloride |
| Synonyms | Source |
|---|---|
| 2-methoxy-6-chloro-9-(2-chloroethylaminopropylamino)acridine dihydrochloride | ChemIDplus |
| 6-chloro-9-[3-(2-chloroethylamino)propylamino]-2-methoxyacridine dihydrochloride | ChEBI |
| acridine half-mustard.2HCl | ChEBI |
| acridine mutagen ICR 191 | ChEBI |
| Ames mutagen 191 | ChEBI |
| N-(2-chloroethyl)-N'-(6-chloro-2-methoxyacridin-9-yl)propane-1,3-bis(aminium) dichloride | IUPAC |
| Registry Numbers | Sources |
|---|---|
| Reaxys:8176205 | Reaxys |
| CAS:17070-45-0 | ChemIDplus |