EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H21Cl2N3O |
| Net Charge | 0 |
| Average Mass | 378.303 |
| Monoisotopic Mass | 377.10617 |
| SMILES | COc1ccc2nc3cc(Cl)ccc3c(NCCCNCCCl)c2c1 |
| InChI | InChI=1S/C19H21Cl2N3O/c1-25-14-4-6-17-16(12-14)19(23-9-2-8-22-10-7-20)15-5-3-13(21)11-18(15)24-17/h3-6,11-12,22H,2,7-10H2,1H3,(H,23,24) |
| InChIKey | OAPNFEMIOBGOHM-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | mutagen An agent that increases the frequency of mutations above the normal background level, usually by interacting directly with DNA and causing it damage, including base substitution. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| acridine half-mustard (CHEBI:132980) has role mutagen (CHEBI:25435) |
| acridine half-mustard (CHEBI:132980) is a aminoacridines (CHEBI:51803) |
| acridine half-mustard (CHEBI:132980) is a aromatic ether (CHEBI:35618) |
| acridine half-mustard (CHEBI:132980) is a organochlorine compound (CHEBI:36683) |
| acridine half-mustard (CHEBI:132980) is a secondary amino compound (CHEBI:50995) |
| acridine half-mustard (CHEBI:132980) is conjugate base of acridine half-mustard(2+) (CHEBI:132981) |
| Incoming Relation(s) |
| acridine half-mustard(2+) (CHEBI:132981) is conjugate acid of acridine half-mustard (CHEBI:132980) |
| IUPAC Name |
|---|
| N-(2-chloroethyl)-N'-(6-chloro-2-methoxyacridin-9-yl)propane-1,3-diamine |
| Synonyms | Source |
|---|---|
| N-(2-chloroethyl)-N'-(6-chloro-2-methoxy-9-acridinyl)-1,3-propanediamine | ChemIDplus |
| ICR 191 | ChemIDplus |
| ICR-191 | ChEBI |
| 6-chloro-9-[3-(2-chloroethylamino)propylamino]-2-methoxyacridine | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:444928 | Reaxys |
| CAS:17070-44-9 | ChemIDplus |
| Citations |
|---|