EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H13ClFNO4 |
| Net Charge | 0 |
| Average Mass | 349.745 |
| Monoisotopic Mass | 349.05171 |
| SMILES | C#CCOC(=O)[C@@H](C)Oc1ccc(Oc2ncc(Cl)cc2F)cc1 |
| InChI | InChI=1S/C17H13ClFNO4/c1-3-8-22-17(21)11(2)23-13-4-6-14(7-5-13)24-16-15(19)9-12(18)10-20-16/h1,4-7,9-11H,8H2,2H3/t11-/m1/s1 |
| InChIKey | JBDHZKLJNAIJNC-LLVKDONJSA-N |
| Roles Classification |
|---|
| Biological Role: | EC 6.4.1.2 (acetyl-CoA carboxylase) inhibitor An EC 6.4.1.* (C‒C bond-forming ligase) inhibitor that interferes with the action of acetyl-CoA carboxylase (EC 6.4.1.2). |
| Applications: | agrochemical An agrochemical is a substance that is used in agriculture or horticulture. herbicide A substance used to destroy plant pests. agrochemical An agrochemical is a substance that is used in agriculture or horticulture. herbicide A substance used to destroy plant pests. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| clodinafop-propargyl (CHEBI:132921) has functional parent clodinafop (CHEBI:132841) |
| clodinafop-propargyl (CHEBI:132921) has functional parent prop-2-yn-1-ol (CHEBI:28905) |
| clodinafop-propargyl (CHEBI:132921) has role agrochemical (CHEBI:33286) |
| clodinafop-propargyl (CHEBI:132921) has role EC 6.4.1.2 (acetyl-CoA carboxylase) inhibitor (CHEBI:70722) |
| clodinafop-propargyl (CHEBI:132921) has role herbicide (CHEBI:24527) |
| clodinafop-propargyl (CHEBI:132921) is a aromatic ether (CHEBI:35618) |
| clodinafop-propargyl (CHEBI:132921) is a carboxylic ester (CHEBI:33308) |
| clodinafop-propargyl (CHEBI:132921) is a organochlorine compound (CHEBI:36683) |
| clodinafop-propargyl (CHEBI:132921) is a organofluorine compound (CHEBI:37143) |
| clodinafop-propargyl (CHEBI:132921) is a propyzamide (CHEBI:34935) |
| clodinafop-propargyl (CHEBI:132921) is a pyridines (CHEBI:26421) |
| IUPAC Name |
|---|
| prop-2-yn-1-yl (2R)-2-{4-[(5-chloro-3-fluoropyridin-2-yl)oxy]phenoxy}propanoate |
| Synonyms | Source |
|---|---|
| 2-propynyl (2R)-2-[4-[(5-chloro-3-fluoro-2-pyridinyl)oxy]phenoxy]propanoate | Alan Wood's Pesticides |
| clodinafop propargyl ester | ChEBI |
| (R)-2-(4-((5-chloro-3-fluoro-2-pyridinyl)oxy)phenoxy)propionic acid 2-propynyl ester | ChemIDplus |
| prop-2-ynyl (R)-2-[4-(5-chloro-3-fluoro-2-pyridyloxy)phenoxy]propionate | Alan Wood's Pesticides |
| Brand Name | Source |
|---|---|
| Topik | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| 165 | PPDB |
| derivatives/clodinafop-propargyl | Alan Wood's Pesticides |
| EP248968 | Patent |
| US47133109 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:8857008 | Reaxys |
| CAS:105512-06-9 | ChemIDplus |
| CAS:105512-06-9 | Alan Wood's Pesticides |
| Citations |
|---|