EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H11ClFNO4 |
| Net Charge | 0 |
| Average Mass | 311.696 |
| Monoisotopic Mass | 311.03606 |
| SMILES | C[C@@H](Oc1ccc(Oc2ncc(Cl)cc2F)cc1)C(=O)O |
| InChI | InChI=1S/C14H11ClFNO4/c1-8(14(18)19)20-10-2-4-11(5-3-10)21-13-12(16)6-9(15)7-17-13/h2-8H,1H3,(H,18,19)/t8-/m1/s1 |
| InChIKey | YUIKUTLBPMDDNQ-MRVPVSSYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | EC 6.4.1.2 (acetyl-CoA carboxylase) inhibitor An EC 6.4.1.* (C‒C bond-forming ligase) inhibitor that interferes with the action of acetyl-CoA carboxylase (EC 6.4.1.2). |
| Application: | phenoxy herbicide Any member of the class of herbicides whose members contain a phenoxy or substituted phenoxy group. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| clodinafop (CHEBI:132841) has role EC 6.4.1.2 (acetyl-CoA carboxylase) inhibitor (CHEBI:70722) |
| clodinafop (CHEBI:132841) has role phenoxy herbicide (CHEBI:60575) |
| clodinafop (CHEBI:132841) is a aromatic ether (CHEBI:35618) |
| clodinafop (CHEBI:132841) is a monocarboxylic acid (CHEBI:25384) |
| clodinafop (CHEBI:132841) is a organochlorine compound (CHEBI:36683) |
| clodinafop (CHEBI:132841) is a organofluorine compound (CHEBI:37143) |
| clodinafop (CHEBI:132841) is a pyridines (CHEBI:26421) |
| Incoming Relation(s) |
| clodinafop-propargyl (CHEBI:132921) has functional parent clodinafop (CHEBI:132841) |
| IUPAC Name |
|---|
| (2R)-2-{4-[(5-chloro-3-fluoropyridin-2-yl)oxy]phenoxy}propanoic acid |
| Synonyms | Source |
|---|---|
| (2R)-2-[4-[(5-chloro-3-fluoro-2-pyridinyl)oxy]phenoxy]propanoic acid | SUBMITTER |
| (R)-2-[4-(5-chloro-3-fluoro-2-pyridyloxy)phenoxy]propionic acid | SUBMITTER |
| (R)-2-{4-[(5-chloro-3-fluoropyridin-2-yl)oxy]phenoxy}propionic acid | SUBMITTER |
| Manual Xrefs | Databases |
|---|---|
| 1416 | PPDB |
| clodinafop | Alan Wood's Pesticides |
| Registry Numbers | Sources |
|---|---|
| Reaxys:10562170 | Reaxys |
| CAS:114420-56-3 | ChemIDplus |
| Citations |
|---|