EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H32O15 |
| Net Charge | 0 |
| Average Mass | 632.571 |
| Monoisotopic Mass | 632.17412 |
| SMILES | [H][C@@]12C[C@@]3(O[C@@H]4O[C@H](COC(=O)c5cc(O)c(O)c(O)c5)[C@@H](O)[C@H](O)[C@H]4O)[C@]1(COC(=O)c1ccccc1)C(=O)O[C@@]3(C)C[C@H]2O |
| InChI | InChI=1S/C30H32O15/c1-28-10-18(33)15-9-30(28,29(15,27(40)45-28)12-42-24(38)13-5-3-2-4-6-13)44-26-23(37)22(36)21(35)19(43-26)11-41-25(39)14-7-16(31)20(34)17(32)8-14/h2-8,15,18-19,21-23,26,31-37H,9-12H2,1H3/t15-,18+,19+,21+,22-,23+,26-,28-,29-,30-/m0/s1 |
| InChIKey | NKYKOCKNAQIWRZ-QKYHNZPSSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Paeonia lactiflora (ncbitaxon:35924) | root (BTO:0001188) | PubMed (19721258) |
| Roles Classification |
|---|
| Biological Roles: | androgen antagonist A compound which inhibits or antagonises the biosynthesis or actions of androgens. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| Applications: | androgen antagonist A compound which inhibits or antagonises the biosynthesis or actions of androgens. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 6'-O-galloylalbiflorin (CHEBI:132816) has functional parent albiflorin (CHEBI:132793) |
| 6'-O-galloylalbiflorin (CHEBI:132816) has role androgen antagonist (CHEBI:35497) |
| 6'-O-galloylalbiflorin (CHEBI:132816) has role antineoplastic agent (CHEBI:35610) |
| 6'-O-galloylalbiflorin (CHEBI:132816) has role plant metabolite (CHEBI:76924) |
| 6'-O-galloylalbiflorin (CHEBI:132816) is a bridged compound (CHEBI:35990) |
| 6'-O-galloylalbiflorin (CHEBI:132816) is a gallate ester (CHEBI:37576) |
| 6'-O-galloylalbiflorin (CHEBI:132816) is a monoterpene glycoside (CHEBI:72293) |
| 6'-O-galloylalbiflorin (CHEBI:132816) is a secondary alcohol (CHEBI:35681) |
| 6'-O-galloylalbiflorin (CHEBI:132816) is a β-D-glucoside (CHEBI:22798) |
| 6'-O-galloylalbiflorin (CHEBI:132816) is a γ-lactone (CHEBI:37581) |
| Synonym | Source |
|---|---|
| 6'-galloylalbiflorin | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:20005611 | Reaxys |
| Citations |
|---|