EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H28O11 |
| Net Charge | 0 |
| Average Mass | 480.466 |
| Monoisotopic Mass | 480.16316 |
| SMILES | [H][C@@]12C[C@@]3(O[C@@H]4O[C@H](CO)[C@@H](O)[C@H](O)[C@H]4O)[C@]1(COC(=O)c1ccccc1)C(=O)O[C@@]3(C)C[C@H]2O |
| InChI | InChI=1S/C23H28O11/c1-21-8-13(25)12-7-23(21,33-19-17(28)16(27)15(26)14(9-24)32-19)22(12,20(30)34-21)10-31-18(29)11-5-3-2-4-6-11/h2-6,12-17,19,24-28H,7-10H2,1H3/t12-,13+,14+,15+,16-,17+,19-,21-,22-,23-/m0/s1 |
| InChIKey | QQUHMASGPODSIW-ICECTASOSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Paeonia lactiflora (ncbitaxon:35924) | root (BTO:0001188) | PubMed (27429639) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| Application: | neuroprotective agent Any compound that can be used for the treatment of neurodegenerative disorders. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| albiflorin (CHEBI:132793) has role neuroprotective agent (CHEBI:63726) |
| albiflorin (CHEBI:132793) has role plant metabolite (CHEBI:76924) |
| albiflorin (CHEBI:132793) is a benzoate ester (CHEBI:36054) |
| albiflorin (CHEBI:132793) is a bridged compound (CHEBI:35990) |
| albiflorin (CHEBI:132793) is a monoterpene glycoside (CHEBI:72293) |
| albiflorin (CHEBI:132793) is a secondary alcohol (CHEBI:35681) |
| albiflorin (CHEBI:132793) is a β-D-glucoside (CHEBI:22798) |
| albiflorin (CHEBI:132793) is a γ-lactone (CHEBI:37581) |
| Incoming Relation(s) |
| 6'-O-galloylalbiflorin (CHEBI:132816) has functional parent albiflorin (CHEBI:132793) |
| IUPAC Name |
|---|
| [(1R,3R,4R,6S,9S)-1-(β-D-glucopyranosyloxy)-4-hydroxy-6-methyl-8-oxo-7-oxatricyclo[4.3.0.03,9]nonan-9-yl]methyl benzoate |
| Registry Numbers | Sources |
|---|---|
| Reaxys:18602070 | Reaxys |
| CAS:39011-90-0 | KEGG COMPOUND |
| CAS:39011-90-0 | ChemIDplus |
| Citations |
|---|