EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H16NO3 |
| Net Charge | +1 |
| Average Mass | 150.198 |
| Monoisotopic Mass | 150.11247 |
| SMILES | OCC[NH+](CCO)CCO |
| InChI | InChI=1S/C6H15NO3/c8-4-1-7(2-5-9)3-6-10/h8-10H,1-6H2/p+1 |
| InChIKey | GSEJCLTVZPLZKY-UHFFFAOYSA-O |
| Roles Classification |
|---|
| Chemical Role: | buffer Any substance or mixture of substances that, in solution (typically aqueous), resists change in pH upon addition of small amounts of acid or base. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| triethanolammonium (CHEBI:132755) has role buffer (CHEBI:35225) |
| triethanolammonium (CHEBI:132755) is a ammonium ion derivative (CHEBI:35274) |
| triethanolammonium (CHEBI:132755) is a organic cation (CHEBI:25697) |
| triethanolammonium (CHEBI:132755) is conjugate acid of triethanolamine (CHEBI:28621) |
| Incoming Relation(s) |
| triethanolamine hydrochloride (CHEBI:132753) has part triethanolammonium (CHEBI:132755) |
| triethanolamine (CHEBI:28621) is conjugate base of triethanolammonium (CHEBI:132755) |
| IUPAC Name |
|---|
| 2-hydroxy-N,N-bis(2-hydroxyethyl)ethan-1-aminium |
| Synonym | Source |
|---|---|
| triethanolamine(1+) | ChEBI |