EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H15NO3.HCl |
| Net Charge | 0 |
| Average Mass | 185.651 |
| Monoisotopic Mass | 185.08187 |
| SMILES | Cl.OCCN(CCO)CCO |
| InChI | InChI=1S/C6H15NO3.ClH/c8-4-1-7(2-5-9)3-6-10;/h8-10H,1-6H2;1H |
| InChIKey | HHLJUSLZGFYWKW-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | surfactant A substance which lowers the surface tension of the medium in which it is dissolved, and/or the interfacial tension with other phases, and, accordingly, is positively adsorbed at the liquid/vapour and/or at other interfaces. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| triethanolamine hydrochloride (CHEBI:132753) has part triethanolammonium (CHEBI:132755) |
| triethanolamine hydrochloride (CHEBI:132753) has role surfactant (CHEBI:35195) |
| triethanolamine hydrochloride (CHEBI:132753) is a hydrochloride (CHEBI:36807) |
| IUPAC Names |
|---|
| 2,2',2''-nitrilotri(ethan-1-ol) hydrochloride |
| 2-hydroxy-N,N-bis(2-hydroxyethyl)ethan-1-aminium chloride |
| Synonyms | Source |
|---|---|
| 2,2',2''-Nitrilotrisethanol hydrochloride | ChemIDplus |
| 2,2',2''-Nitrilotriethanol hydrochloride | ChemIDplus |
| TEA-Hydrochloride | ChemIDplus |
| Triethanolammonium chloride | ChemIDplus |
| Tris(2-hydroxyethyl)ammonium chloride | ChemIDplus |
| tris(2-hydroxyethyl)amine hydrochloride | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| CPD0-2430 | MetaCyc |
| Triethanolamine | Wikipedia |