EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H15NO3 |
| Net Charge | 0 |
| Average Mass | 149.190 |
| Monoisotopic Mass | 149.10519 |
| SMILES | OCCN(CCO)CCO |
| InChI | InChI=1S/C6H15NO3/c8-4-1-7(2-5-9)3-6-10/h8-10H,1-6H2 |
| InChIKey | GSEJCLTVZPLZKY-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Roles: | buffer Any substance or mixture of substances that, in solution (typically aqueous), resists change in pH upon addition of small amounts of acid or base. surfactant A substance which lowers the surface tension of the medium in which it is dissolved, and/or the interfacial tension with other phases, and, accordingly, is positively adsorbed at the liquid/vapour and/or at other interfaces. Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| triethanolamine (CHEBI:28621) has functional parent triethylamine (CHEBI:35026) |
| triethanolamine (CHEBI:28621) has role buffer (CHEBI:35225) |
| triethanolamine (CHEBI:28621) has role surfactant (CHEBI:35195) |
| triethanolamine (CHEBI:28621) is a amino alcohol (CHEBI:22478) |
| triethanolamine (CHEBI:28621) is a tertiary amino compound (CHEBI:50996) |
| triethanolamine (CHEBI:28621) is a triol (CHEBI:27136) |
| triethanolamine (CHEBI:28621) is conjugate base of triethanolammonium (CHEBI:132755) |
| Incoming Relation(s) |
| triethanolammonium (CHEBI:132755) is conjugate acid of triethanolamine (CHEBI:28621) |
| IUPAC Name |
|---|
| 2,2',2''-nitrilotriethanol |
| Synonyms | Source |
|---|---|
| 2,2',2''-NITRILOTRIETHANOL | PDBeChem |
| 2,2',2''-nitrilotris(ethanol) | ChemIDplus |
| H3tea | IUPAC |
| N(CH2CH2OH)3 | NIST Chemistry WebBook |
| nitrilo-2,2',2''-triethanol | NIST Chemistry WebBook |
| nitrilotriethanol | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| 211 | PDBeChem |
| 2768 | DrugCentral |
| c0491 | UM-BBD |
| C06771 | KEGG COMPOUND |
| CPD0-2459 | MetaCyc |
| D00215 | KEGG DRUG |
| HMDB0032538 | HMDB |
| Triethanolamine | Wikipedia |
| Citations |
|---|