EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H9NO2 |
| Net Charge | 0 |
| Average Mass | 187.198 |
| Monoisotopic Mass | 187.06333 |
| SMILES | O=C(O)/C=C/c1cnc2ccccc12 |
| InChI | InChI=1S/C11H9NO2/c13-11(14)6-5-8-7-12-10-4-2-1-3-9(8)10/h1-7,12H,(H,13,14)/b6-5+ |
| InChIKey | PLVPPLCLBIEYEA-AATRIKPKSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (E)-3-(indol-3-yl)acrylic acid (CHEBI:132244) has functional parent acrylic acid (CHEBI:18308) |
| (E)-3-(indol-3-yl)acrylic acid (CHEBI:132244) is a indoles (CHEBI:24828) |
| (E)-3-(indol-3-yl)acrylic acid (CHEBI:132244) is a α,β-unsaturated monocarboxylic acid (CHEBI:79020) |
| (E)-3-(indol-3-yl)acrylic acid (CHEBI:132244) is conjugate acid of (E)-3-(indol-3-yl)acrylate(1−) (CHEBI:131929) |
| Incoming Relation(s) |
| (E)-3-(indol-3-yl)acrylate(1−) (CHEBI:131929) is conjugate base of (E)-3-(indol-3-yl)acrylic acid (CHEBI:132244) |
| IUPAC Name |
|---|
| (2E)-3-(1H-indol-3-yl)prop-2-enoic acid |
| Synonyms | Source |
|---|---|
| Indole-3-acrylic acid | ChemIDplus |
| trans-3-Indoleacrylic acid | ChemIDplus |
| trans-beta-Indoleacrylic acid | ChemIDplus |
| Indoleacrylic acid | ChemIDplus |
| 3-indoleacrylic acid | ChEBI |
| indole-3β-acrylic acid | MetaCyc |
| Manual Xrefs | Databases |
|---|---|
| CPD-11578 | MetaCyc |
| Registry Numbers | Sources |
|---|---|
| Reaxys:6317 | Reaxys |
| CAS:29953-71-7 | ChemIDplus |
| Citations |
|---|