EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H8NO2 |
| Net Charge | -1 |
| Average Mass | 186.190 |
| Monoisotopic Mass | 186.05605 |
| SMILES | O=C([O-])/C=C/c1cnc2ccccc12 |
| InChI | InChI=1S/C11H9NO2/c13-11(14)6-5-8-7-12-10-4-2-1-3-9(8)10/h1-7,12H,(H,13,14)/p-1/b6-5+ |
| InChIKey | PLVPPLCLBIEYEA-AATRIKPKSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (E)-3-(indol-3-yl)acrylate(1−) (CHEBI:131929) is a monocarboxylic acid anion (CHEBI:35757) |
| (E)-3-(indol-3-yl)acrylate(1−) (CHEBI:131929) is conjugate base of (E)-3-(indol-3-yl)acrylic acid (CHEBI:132244) |
| Incoming Relation(s) |
| (E)-3-(indol-3-yl)acrylic acid (CHEBI:132244) is conjugate acid of (E)-3-(indol-3-yl)acrylate(1−) (CHEBI:131929) |
| IUPAC Name |
|---|
| (2E)-3-(1H-indol-3-yl)prop-2-enoate |
| UniProt Name | Source |
|---|---|
| (E)-3-(indol-3-yl)acrylate | UniProt |
| Manual Xrefs | Databases |
|---|---|
| CPD-11578 | MetaCyc |
| Citations |
|---|