EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H8O3 |
| Net Charge | 0 |
| Average Mass | 116.116 |
| Monoisotopic Mass | 116.04734 |
| SMILES | CC(C)=C(O)C(=O)O |
| InChI | InChI=1S/C5H8O3/c1-3(2)4(6)5(7)8/h6H,1-2H3,(H,7,8) |
| InChIKey | YXHQZJPTLDUABH-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Pseudomonas putida DOT-T1E (ncbitaxon:1196325) | - | MetaboLights (MTBLS319) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-hydroxy-3-methyl-2-butenoic acid (CHEBI:132177) has functional parent 3-methylbut-2-enoic acid (CHEBI:37127) |
| 2-hydroxy-3-methyl-2-butenoic acid (CHEBI:132177) is a 2-hydroxy monocarboxylic acid (CHEBI:49302) |
| 2-hydroxy-3-methyl-2-butenoic acid (CHEBI:132177) is a α,β-unsaturated monocarboxylic acid (CHEBI:79020) |
| 2-hydroxy-3-methyl-2-butenoic acid (CHEBI:132177) is tautomer of 3-methyl-2-oxobutanoic acid (CHEBI:16530) |
| Incoming Relation(s) |
| 3-methyl-2-oxobutanoic acid (CHEBI:16530) is tautomer of 2-hydroxy-3-methyl-2-butenoic acid (CHEBI:132177) |
| IUPAC Name |
|---|
| 2-hydroxy-3-methylbut-2-enoic acid |
| Manual Xrefs | Databases |
|---|---|
| 28716810 | ChemSpider |