EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H8O3 |
| Net Charge | 0 |
| Average Mass | 116.116 |
| Monoisotopic Mass | 116.04734 |
| SMILES | CC(C)C(=O)C(=O)O |
| InChI | InChI=1S/C5H8O3/c1-3(2)4(6)5(7)8/h3H,1-2H3,(H,7,8) |
| InChIKey | QHKABHOOEWYVLI-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | - | PubMed (7021997) | |
| Saccharomyces cerevisiae (ncbitaxon:4932) | - | PubMed (9748245) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). Saccharomyces cerevisiae metabolite Any fungal metabolite produced during a metabolic reaction in Baker's yeast (Saccharomyces cerevisiae ). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-methyl-2-oxobutanoic acid (CHEBI:16530) has functional parent butyric acid (CHEBI:30772) |
| 3-methyl-2-oxobutanoic acid (CHEBI:16530) has role Saccharomyces cerevisiae metabolite (CHEBI:75772) |
| 3-methyl-2-oxobutanoic acid (CHEBI:16530) has role human metabolite (CHEBI:77746) |
| 3-methyl-2-oxobutanoic acid (CHEBI:16530) is a 2-oxo monocarboxylic acid (CHEBI:35910) |
| 3-methyl-2-oxobutanoic acid (CHEBI:16530) is a branched-chain keto acid (CHEBI:191197) |
| 3-methyl-2-oxobutanoic acid (CHEBI:16530) is conjugate acid of 3-methyl-2-oxobutanoate (CHEBI:11851) |
| 3-methyl-2-oxobutanoic acid (CHEBI:16530) is tautomer of 2-hydroxy-3-methyl-2-butenoic acid (CHEBI:132177) |
| Incoming Relation(s) |
| 3-methyl-2-oxobutanoate (CHEBI:11851) is conjugate base of 3-methyl-2-oxobutanoic acid (CHEBI:16530) |
| 2-hydroxy-3-methyl-2-butenoic acid (CHEBI:132177) is tautomer of 3-methyl-2-oxobutanoic acid (CHEBI:16530) |
| IUPAC Name |
|---|
| 3-methyl-2-oxobutanoic acid |
| Synonyms | Source |
|---|---|
| 2-Keto-3-methylbutyric acid | KEGG COMPOUND |
| 2-Ketoisovaleric acid | HMDB |
| 2-Ketovaline | KEGG COMPOUND |
| 2-Oxo-3-methylbutanoic acid | HMDB |
| 2-Oxo-3-methylbutyric acid | HMDB |
| 2-Oxoisovaleric acid | HMDB |
| Manual Xrefs | Databases |
|---|---|
| 2-KETO-ISOVALERATE | MetaCyc |
| C00007623 | KNApSAcK |
| C00141 | KEGG COMPOUND |
| DB04074 | DrugBank |
| HMDB0000019 | HMDB |
| KIV | PDBeChem |
| LMFA01020274 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1744951 | Reaxys |
| CAS:759-05-7 | ChemIDplus |
| CAS:759-05-7 | KEGG COMPOUND |
| Citations |
|---|