EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C3H5O3 |
| Net Charge | -1 |
| Average Mass | 89.070 |
| Monoisotopic Mass | 89.02442 |
| SMILES | COCC(=O)[O-] |
| InChI | InChI=1S/C3H6O3/c1-6-2-3(4)5/h2H2,1H3,(H,4,5)/p-1 |
| InChIKey | RMIODHQZRUFFFF-UHFFFAOYSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| methoxyacetate (CHEBI:132097) is a monocarboxylic acid anion (CHEBI:35757) |
| methoxyacetate (CHEBI:132097) is conjugate base of methoxyacetic acid (CHEBI:132098) |
| Incoming Relation(s) |
| sodium methoxyacetate (CHEBI:132096) has part methoxyacetate (CHEBI:132097) |
| methoxyacetic acid (CHEBI:132098) is conjugate acid of methoxyacetate (CHEBI:132097) |
| IUPAC Name |
|---|
| methoxyacetate |
| Manual Xrefs | Databases |
|---|---|
| CPD-12993 | MetaCyc |
| Registry Numbers | Sources |
|---|---|
| Reaxys:3536277 | Reaxys |