EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C3H5O3.Na |
| Net Charge | 0 |
| Average Mass | 112.060 |
| Monoisotopic Mass | 112.01364 |
| SMILES | COCC(=O)[O-].[Na+] |
| InChI | InChI=1S/C3H6O3.Na/c1-6-2-3(4)5;/h2H2,1H3,(H,4,5);/q;+1/p-1 |
| InChIKey | CEWQOBFWNPUNRO-UHFFFAOYSA-M |
| Roles Classification |
|---|
| Biological Roles: | human xenobiotic metabolite Any human metabolite produced by metabolism of a xenobiotic compound in humans. apoptosis inducer Any substance that induces the process of apoptosis (programmed cell death) in multi-celled organisms. mutagen An agent that increases the frequency of mutations above the normal background level, usually by interacting directly with DNA and causing it damage, including base substitution. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| sodium methoxyacetate (CHEBI:132096) has part methoxyacetate (CHEBI:132097) |
| sodium methoxyacetate (CHEBI:132096) has role antineoplastic agent (CHEBI:35610) |
| sodium methoxyacetate (CHEBI:132096) has role apoptosis inducer (CHEBI:68495) |
| sodium methoxyacetate (CHEBI:132096) has role human xenobiotic metabolite (CHEBI:76967) |
| sodium methoxyacetate (CHEBI:132096) has role mutagen (CHEBI:25435) |
| sodium methoxyacetate (CHEBI:132096) is a organic sodium salt (CHEBI:38700) |
| IUPAC Name |
|---|
| sodium methoxyacetate |
| Synonym | Source |
|---|---|
| Methoxyacetic acid sodium salt | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Reaxys:3704466 | Reaxys |
| CAS:50402-70-5 | ChemIDplus |
| Citations |
|---|