EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C3H5O3.Na |
| Net Charge | 0 |
| Average Mass | 112.060 |
| Monoisotopic Mass | 112.01364 |
| SMILES | COCC(=O)[O-].[Na+] |
| InChI | InChI=1S/C3H6O3.Na/c1-6-2-3(4)5;/h2H2,1H3,(H,4,5);/q;+1/p-1 |
| InChIKey | CEWQOBFWNPUNRO-UHFFFAOYSA-M |
| Roles Classification |
|---|
| Biological Roles: | human xenobiotic metabolite Any human metabolite produced by metabolism of a xenobiotic compound in humans. mutagen An agent that increases the frequency of mutations above the normal background level, usually by interacting directly with DNA and causing it damage, including base substitution. apoptosis inducer Any substance that induces the process of apoptosis (programmed cell death) in multi-celled organisms. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| sodium methoxyacetate (CHEBI:132096) has part methoxyacetate (CHEBI:132097) |
| sodium methoxyacetate (CHEBI:132096) has role antineoplastic agent (CHEBI:35610) |
| sodium methoxyacetate (CHEBI:132096) has role apoptosis inducer (CHEBI:68495) |
| sodium methoxyacetate (CHEBI:132096) has role human xenobiotic metabolite (CHEBI:76967) |
| sodium methoxyacetate (CHEBI:132096) has role mutagen (CHEBI:25435) |
| sodium methoxyacetate (CHEBI:132096) is a organic sodium salt (CHEBI:38700) |
| IUPAC Name |
|---|
| sodium methoxyacetate |
| Synonym | Source |
|---|---|
| Methoxyacetic acid sodium salt | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Reaxys:3704466 | Reaxys |
| CAS:50402-70-5 | ChemIDplus |
| Citations |
|---|