EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H31O3 |
| Net Charge | -1 |
| Average Mass | 319.465 |
| Monoisotopic Mass | 319.22787 |
| SMILES | CCCCC/C=C\C[C@@H]1O[C@@H]1C/C=C\C/C=C\CCCC(=O)[O-] |
| InChI | InChI=1S/C20H32O3/c1-2-3-4-5-9-12-15-18-19(23-18)16-13-10-7-6-8-11-14-17-20(21)22/h6,8-10,12-13,18-19H,2-5,7,11,14-17H2,1H3,(H,21,22)/p-1/b8-6-,12-9-,13-10-/t18-,19+/m0/s1 |
| InChIKey | DXOYQVHGIODESM-MFYAFOOZSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (11R,12S)-EET(1−) (CHEBI:131970) is a 11,12-EET(1−) (CHEBI:76625) |
| (11R,12S)-EET(1−) (CHEBI:131970) is conjugate base of (11R,12S)-EET (CHEBI:132277) |
| (11R,12S)-EET(1−) (CHEBI:131970) is enantiomer of (11S,12R)-EET(1−) (CHEBI:131969) |
| Incoming Relation(s) |
| (11R,12S)-EET (CHEBI:132277) is conjugate acid of (11R,12S)-EET(1−) (CHEBI:131970) |
| (11S,12R)-EET(1−) (CHEBI:131969) is enantiomer of (11R,12S)-EET(1−) (CHEBI:131970) |
| IUPAC Name |
|---|
| (5Z,8Z)-10-{(2R,3S)-3-[(2Z)-oct-2-en-1-yl]oxiran-2-yl}deca-5,8-dienoate |
| Synonyms | Source |
|---|---|
| 11(R),12(S)-EET(1−) | ChEBI |
| (11R,12S)-EpETrE(1−) | ChEBI |
| (11R,12S)-epoxy-(5Z,8Z,14Z)-icosatrienoate | ChEBI |
| UniProt Name | Source |
|---|---|
| (11R,12S)-epoxy-(5Z,8Z,14Z)-eicosatrienoate | UniProt |
| Citations |
|---|