EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H31O3 |
| Net Charge | -1 |
| Average Mass | 319.465 |
| Monoisotopic Mass | 319.22787 |
| SMILES | CCCCC/C=C\CC1OC1C/C=C\C/C=C\CCCC(=O)[O-] |
| InChI | InChI=1S/C20H32O3/c1-2-3-4-5-9-12-15-18-19(23-18)16-13-10-7-6-8-11-14-17-20(21)22/h6,8-10,12-13,18-19H,2-5,7,11,14-17H2,1H3,(H,21,22)/p-1/b8-6-,12-9-,13-10- |
| InChIKey | DXOYQVHGIODESM-KROJNAHFSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 11,12-EET(1−) (CHEBI:76625) has functional parent arachidonate (CHEBI:32395) |
| 11,12-EET(1−) (CHEBI:76625) is a EET(1−) (CHEBI:131865) |
| 11,12-EET(1−) (CHEBI:76625) is a long-chain fatty acid anion (CHEBI:57560) |
| 11,12-EET(1−) (CHEBI:76625) is a polyunsaturated fatty acid anion (CHEBI:76567) |
| 11,12-EET(1−) (CHEBI:76625) is conjugate base of 11,12-EET (CHEBI:34130) |
| Incoming Relation(s) |
| 11,12-epoxy-20-hydroxy-(5Z,8Z,14Z)-icosatrienoate (CHEBI:137475) has functional parent 11,12-EET(1−) (CHEBI:76625) |
| (11R,12S)-EET(1−) (CHEBI:131970) is a 11,12-EET(1−) (CHEBI:76625) |
| (11S,12R)-EET(1−) (CHEBI:131969) is a 11,12-EET(1−) (CHEBI:76625) |
| 11,12-EET (CHEBI:34130) is conjugate acid of 11,12-EET(1−) (CHEBI:76625) |
| IUPAC Name |
|---|
| (5Z,8Z)-10-{3-[(2Z)-oct-2-en-1-yl]oxiran-2-yl}deca-5,8-dienoate |
| Synonyms | Source |
|---|---|
| 11,12-epoxy-(5Z,8Z,14Z)-icosatrienoate | SUBMITTER |
| 11,12-epoxyarachidonate | ChEBI |
| (5Z,8Z,14Z)-11,12-epoxyeicosatrienoate | ChEBI |
| (5Z,8Z,14Z)-11,12-epoxyicosatrienoate | ChEBI |
| UniProt Name | Source |
|---|---|
| 11,12-epoxy-(5Z,8Z,14Z)-eicosatrienoate | UniProt |