EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H32O3 |
| Net Charge | 0 |
| Average Mass | 320.473 |
| Monoisotopic Mass | 320.23514 |
| SMILES | CCCCC/C=C\C[C@@H]1O[C@@H]1C/C=C\C/C=C\CCCC(=O)O |
| InChI | InChI=1S/C20H32O3/c1-2-3-4-5-9-12-15-18-19(23-18)16-13-10-7-6-8-11-14-17-20(21)22/h6,8-10,12-13,18-19H,2-5,7,11,14-17H2,1H3,(H,21,22)/b8-6-,12-9-,13-10-/t18-,19+/m0/s1 |
| InChIKey | DXOYQVHGIODESM-MFYAFOOZSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Cavia porcellus (ncbitaxon:10141) | - | PubMed (11060896) | |
| Mus musculus (ncbitaxon:10090) | - | PubMed (15084647) | |
| Rattus norvegicus (ncbitaxon:10116) | - | PubMed (9694933) |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | rat metabolite Any mammalian metabolite produced during a metabolic reaction in rat (Rattus norvegicus). xenobiotic metabolite Any metabolite produced by metabolism of a xenobiotic compound. mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Applications: | platelet aggregation inhibitor A drug or agent which antagonizes or impairs any mechanism leading to blood platelet aggregation, whether during the phases of activation and shape change or following the dense-granule release reaction and stimulation of the prostaglandin-thromboxane system. anti-inflammatory drug A substance that reduces or suppresses inflammation. platelet aggregation inhibitor A drug or agent which antagonizes or impairs any mechanism leading to blood platelet aggregation, whether during the phases of activation and shape change or following the dense-granule release reaction and stimulation of the prostaglandin-thromboxane system. anti-inflammatory drug A substance that reduces or suppresses inflammation. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (11R,12S)-EET (CHEBI:132277) has role rat metabolite (CHEBI:86264) |
| (11R,12S)-EET (CHEBI:132277) is a 11,12-EET (CHEBI:34130) |
| (11R,12S)-EET (CHEBI:132277) is conjugate acid of (11R,12S)-EET(1−) (CHEBI:131970) |
| (11R,12S)-EET (CHEBI:132277) is enantiomer of (11S,12R)-EET (CHEBI:132276) |
| Incoming Relation(s) |
| (11R,12S)-EET(1−) (CHEBI:131970) is conjugate base of (11R,12S)-EET (CHEBI:132277) |
| (11S,12R)-EET (CHEBI:132276) is enantiomer of (11R,12S)-EET (CHEBI:132277) |
| IUPAC Name |
|---|
| (5Z,8Z)-10-{(2R,3S)-3-[(2Z)-oct-2-en-1-yl]oxiran-2-yl}deca-5,8-dienoic acid |
| Synonyms | Source |
|---|---|
| 11(R),12(S)-EET | ChEBI |
| (11R,12S)-EpETrE | ChEBI |
| 11(R),12(S)-EpETrE | ChEBI |
| (11R,12S)-epoxy-(5Z,8Z,14Z)-eicosatrienoic acid | ChEBI |
| (11R,12S)-epoxy-(5Z,8Z,14Z)-icosatrienoic acid | ChEBI |
| 11R,12S-EET | LIPID MAPS |
| Manual Xrefs | Databases |
|---|---|
| LMFA03080015 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:4697200 | Reaxys |
| Citations |
|---|