EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H22N4O3 |
| Net Charge | 0 |
| Average Mass | 354.410 |
| Monoisotopic Mass | 354.16919 |
| SMILES | [H][C@]1(C2CC2)C=Cc2c(Cc3cnc(N)nc3N)cc(OC)c(OC)c2O1 |
| InChI | InChI=1S/C19H22N4O3/c1-24-15-8-11(7-12-9-22-19(21)23-18(12)20)13-5-6-14(10-3-4-10)26-16(13)17(15)25-2/h5-6,8-10,14H,3-4,7H2,1-2H3,(H4,20,21,22,23)/t14-/m1/s1 |
| InChIKey | HWJPWWYTGBZDEG-CQSZACIVSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | antibacterial drug A drug used to treat or prevent bacterial infections. EC 1.5.1.3 (dihydrofolate reductase) inhibitor An EC 1.5.1.* (oxidoreductase acting on donor CH-NH group, NAD+ or NADP+ as acceptor) inhibitor that interferes with the action of dihydrofolate reductase (EC 1.5.1.3). |
| Application: | antibacterial drug A drug used to treat or prevent bacterial infections. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (S)-iclaprim (CHEBI:131753) has role antibacterial drug (CHEBI:36047) |
| (S)-iclaprim (CHEBI:131753) has role EC 1.5.1.3 (dihydrofolate reductase) inhibitor (CHEBI:50683) |
| (S)-iclaprim (CHEBI:131753) is a 5-[(2-cyclopropyl-7,8-dimethoxy-2H-chromen-5-yl)methyl]pyrimidine-2,4-diamine (CHEBI:131751) |
| (S)-iclaprim (CHEBI:131753) is enantiomer of (R)-iclaprim (CHEBI:131752) |
| Incoming Relation(s) |
| iclaprim (CHEBI:131724) has part (S)-iclaprim (CHEBI:131753) |
| (R)-iclaprim (CHEBI:131752) is enantiomer of (S)-iclaprim (CHEBI:131753) |
| IUPAC Name |
|---|
| 5-{[(2S)-2-cyclopropyl-7,8-dimethoxy-2H-chromen-5-yl]methyl}pyrimidine-2,4-diamine |
| Synonyms | Source |
|---|---|
| AR 102 | ChEBI |
| AR-102 | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:20535807 | Reaxys |
| Citations |
|---|