EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | H.C7H15N5O4 |
| Net Charge | +1 |
| Average Mass | 234.236 |
| Monoisotopic Mass | 234.11968 |
| SMILES | COC(=O)[C@@H](N)CCCNC(=N)N[N+](=O)[O-].[H+] |
| InChI | InChI=1S/C7H15N5O4/c1-16-6(13)5(8)3-2-4-10-7(9)11-12(14)15/h5H,2-4,8H2,1H3,(H3,9,10,11)/p+1/t5-/m0/s1 |
| InChIKey | KCWZGJVSDFYRIX-YFKPBYRVSA-O |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Nγ-nitro-L-arginine methyl ester(1+) (CHEBI:131183) is a organic cation (CHEBI:25697) |
| Nγ-nitro-L-arginine methyl ester(1+) (CHEBI:131183) is conjugate acid of Nγ-nitro-L-arginine methyl ester (CHEBI:7549) |
| Incoming Relation(s) |
| Nγ-nitro-L-arginine methyl ester hydrochloride (CHEBI:131182) has part Nγ-nitro-L-arginine methyl ester(1+) (CHEBI:131183) |
| Nγ-nitro-L-arginine methyl ester (CHEBI:7549) is conjugate base of Nγ-nitro-L-arginine methyl ester(1+) (CHEBI:131183) |