EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H15N5O4 |
| Net Charge | 0 |
| Average Mass | 233.228 |
| Monoisotopic Mass | 233.11240 |
| SMILES | COC(=O)[C@@H](N)CCCNC(=N)N[N+](=O)[O-] |
| InChI | InChI=1S/C7H15N5O4/c1-16-6(13)5(8)3-2-4-10-7(9)11-12(14)15/h5H,2-4,8H2,1H3,(H3,9,10,11)/t5-/m0/s1 |
| InChIKey | KCWZGJVSDFYRIX-YFKPBYRVSA-N |
| Roles Classification |
|---|
| Biological Role: | EC 1.14.13.39 (nitric oxide synthase) inhibitor An EC 1.14.13.* (oxidoreductase acting on paired donors, incorporating 1 atom of oxygen, with NADH or NADPH as one donor) inhibitor that interferes with the action of nitric oxide synthase (EC 1.14.13.39). |
| Applications: | anti-asthmatic agent Any compound that has anti-asthmatic effects. cardiovascular drug A drug that affects the rate or intensity of cardiac contraction, blood vessel diameter or blood volume. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Nγ-nitro-L-arginine methyl ester (CHEBI:7549) has role anti-asthmatic agent (CHEBI:65023) |
| Nγ-nitro-L-arginine methyl ester (CHEBI:7549) has role cardiovascular drug (CHEBI:35554) |
| Nγ-nitro-L-arginine methyl ester (CHEBI:7549) has role EC 1.14.13.39 (nitric oxide synthase) inhibitor (CHEBI:61908) |
| Nγ-nitro-L-arginine methyl ester (CHEBI:7549) is a N-nitro compound (CHEBI:38780) |
| Nγ-nitro-L-arginine methyl ester (CHEBI:7549) is a L-arginine derivative (CHEBI:83965) |
| Nγ-nitro-L-arginine methyl ester (CHEBI:7549) is a methyl ester (CHEBI:25248) |
| Nγ-nitro-L-arginine methyl ester (CHEBI:7549) is a α-amino acid ester (CHEBI:46874) |
| Nγ-nitro-L-arginine methyl ester (CHEBI:7549) is conjugate base of Nγ-nitro-L-arginine methyl ester(1+) (CHEBI:131183) |
| Incoming Relation(s) |
| Nγ-nitro-L-arginine methyl ester(1+) (CHEBI:131183) is conjugate acid of Nγ-nitro-L-arginine methyl ester (CHEBI:7549) |
| IUPAC Name |
|---|
| methyl N5-(N-nitrocarbamimidoyl)-L-ornithinate |
| Synonyms | Source |
|---|---|
| Arg(NO2)-OMe | ChEBI |
| l-name | ChEMBL |
| L-NAME | ChemIDplus |
| methyl Nγ-nitro-L-argininate | ChEBI |
| N(5)-(Imino(nitroamino)methyl)-L-ornithine methyl ester | ChemIDplus |
| Ngamma-Nitro-L-arginine methyl ester | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C04337 | KEGG COMPOUND |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1714622 | Reaxys |
| CAS:50903-99-6 | ChemIDplus |
| Citations |
|---|