EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H15N5O4.HCl |
| Net Charge | 0 |
| Average Mass | 269.689 |
| Monoisotopic Mass | 269.08908 |
| SMILES | COC(=O)[C@@H](N)CCCNC(=N)N[N+](=O)[O-].Cl |
| InChI | InChI=1S/C7H15N5O4.ClH/c1-16-6(13)5(8)3-2-4-10-7(9)11-12(14)15;/h5H,2-4,8H2,1H3,(H3,9,10,11);1H/t5-;/m0./s1 |
| InChIKey | QBNXAGZYLSRPJK-JEDNCBNOSA-N |
| Roles Classification |
|---|
| Biological Role: | EC 1.14.13.39 (nitric oxide synthase) inhibitor An EC 1.14.13.* (oxidoreductase acting on paired donors, incorporating 1 atom of oxygen, with NADH or NADPH as one donor) inhibitor that interferes with the action of nitric oxide synthase (EC 1.14.13.39). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Nγ-nitro-L-arginine methyl ester hydrochloride (CHEBI:131182) has part Nγ-nitro-L-arginine methyl ester(1+) (CHEBI:131183) |
| Nγ-nitro-L-arginine methyl ester hydrochloride (CHEBI:131182) has role EC 1.14.13.39 (nitric oxide synthase) inhibitor (CHEBI:61908) |
| Nγ-nitro-L-arginine methyl ester hydrochloride (CHEBI:131182) is a hydrochloride (CHEBI:36807) |
| Synonyms | Source |
|---|---|
| Arg(NO2)-OMe·HCl | ChEBI |
| Nγ-nitro-L-arginine methyl ester monohydrochloride | ChEBI |
| LNAME hydrochloride | ChemIDplus |
| methyl Nγ-nitro-L-argininate hydrochloride | ChEBI |
| Methyl N5-(imino(nitroamino)methyl)-L-ornithine monohydrochloride | ChemIDplus |
| L-NAME hydrochloride | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:3744166 | Reaxys |
| CAS:51298-62-5 | ChemIDplus |
| Citations |
|---|