EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H7O3 |
| Net Charge | -1 |
| Average Mass | 163.152 |
| Monoisotopic Mass | 163.04007 |
| SMILES | O=C([O-])/C=C/c1ccccc1O |
| InChI | InChI=1S/C9H8O3/c10-8-4-2-1-3-7(8)5-6-9(11)12/h1-6,10H,(H,11,12)/p-1/b6-5+ |
| InChIKey | PMOWTIHVNWZYFI-AATRIKPKSA-M |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| trans-2-coumarate (CHEBI:12875) is a 2-coumarate (CHEBI:11594) |
| trans-2-coumarate (CHEBI:12875) is conjugate base of trans-2-coumaric acid (CHEBI:18125) |
| Incoming Relation(s) |
| trans-2-coumaric acid (CHEBI:18125) is conjugate acid of trans-2-coumarate (CHEBI:12875) |
| IUPAC Name |
|---|
| (2E)-3-(2-hydroxyphenyl)prop-2-enoate |
| Synonym | Source |
|---|---|
| (2E)-3-(2-hydroxyphenyl)acrylate | ChEBI |
| UniProt Name | Source |
|---|---|
| trans-2-coumarate | UniProt |
| Registry Numbers | Sources |
|---|---|
| Gmelin:1342074 | Gmelin |