EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H7O3 |
| Net Charge | -1 |
| Average Mass | 163.152 |
| Monoisotopic Mass | 163.04007 |
| SMILES | [H]C(=Cc1ccccc1O)C(=O)[O-] |
| InChI | InChI=1S/C9H8O3/c10-8-4-2-1-3-7(8)5-6-9(11)12/h1-6,10H,(H,11,12)/p-1 |
| InChIKey | PMOWTIHVNWZYFI-UHFFFAOYSA-M |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-coumarate (CHEBI:11594) has role plant metabolite (CHEBI:76924) |
| 2-coumarate (CHEBI:11594) is a coumarate (CHEBI:23399) |
| 2-coumarate (CHEBI:11594) is conjugate base of 2-coumaric acid (CHEBI:18176) |
| Incoming Relation(s) |
| cis-2-coumarate (CHEBI:47921) is a 2-coumarate (CHEBI:11594) |
| trans-2-coumarate (CHEBI:12875) is a 2-coumarate (CHEBI:11594) |
| 2-coumaric acid (CHEBI:18176) is conjugate acid of 2-coumarate (CHEBI:11594) |
| IUPAC Name |
|---|
| 3-(2-hydroxyphenyl)prop-2-enoate |
| Synonym | Source |
|---|---|
| 3-(2-hydroxyphenyl)acrylate | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Gmelin:1146630 | Gmelin |
| Beilstein:7022193 | Beilstein |