EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:18125 - trans-2-coumaric acid
| Formula | C9H8O3 |
| Net Charge | 0 |
| Average Mass | 164.160 |
| Monoisotopic Mass | 164.04734 |
| SMILES | O=C(O)/C=C/c1ccccc1O |
| InChI | InChI=1S/C9H8O3/c10-8-4-2-1-3-7(8)5-6-9(11)12/h1-6,10H,(H,11,12)/b6-5+ |
| InChIKey | PMOWTIHVNWZYFI-AATRIKPKSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Roles: | antioxidant A substance that opposes oxidation or inhibits reactions brought about by dioxygen or peroxides. Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| trans-2-coumaric acid (CHEBI:18125) has role antioxidant (CHEBI:22586) |
| trans-2-coumaric acid (CHEBI:18125) has role metabolite (CHEBI:25212) |
| trans-2-coumaric acid (CHEBI:18125) is a 2-coumaric acid (CHEBI:18176) |
| trans-2-coumaric acid (CHEBI:18125) is a phenols (CHEBI:33853) |
| trans-2-coumaric acid (CHEBI:18125) is conjugate acid of trans-2-coumarate (CHEBI:12875) |
| Incoming Relation(s) |
| trans-2-coumarate (CHEBI:12875) is conjugate base of trans-2-coumaric acid (CHEBI:18125) |
| IUPAC Name |
|---|
| (2E)-3-(2-hydroxyphenyl)prop-2-enoic acid |
| Synonyms | Source |
|---|---|
| 2-Coumarate | KEGG COMPOUND |
| trans-2-Hydroxycinnamate | KEGG COMPOUND |
| trans-2-Hydroxycinnamic acid | KEGG COMPOUND |
| 2-Coumaric acid | KEGG COMPOUND |
| o-Coumaric acid | KEGG COMPOUND |
| (2E)-3-(2-HYDROXYPHENYL)ACRYLIC ACID | PDBeChem |
| Manual Xrefs | Databases |
|---|---|
| C01772 | KEGG COMPOUND |
| 2HC | PDBeChem |
| DB01650 | DrugBank |
| HMDB0002641 | HMDB |
| O-Coumaric_acid | Wikipedia |
| Citations |
|---|