EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H12N5O7P |
| Net Charge | 0 |
| Average Mass | 345.208 |
| Monoisotopic Mass | 345.04743 |
| SMILES | Nc1nc(=O)c2ncn([C@@H]3O[C@@H]4COP(=O)(O)O[C@H]4[C@H]3O)c2n1 |
| InChI | InChI=1S/C10H12N5O7P/c11-10-13-7-4(8(17)14-10)12-2-15(7)9-5(16)6-3(21-9)1-20-23(18,19)22-6/h2-3,5-6,9,16H,1H2,(H,18,19)(H3,11,13,14,17)/t3-,5-,6-,9-/m1/s1 |
| InChIKey | ZOOGRGPOEVQQDX-UUOKFMHZSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Escherichia coli (ncbitaxon:562) | - | PubMed (21988831) | |
| Mus musculus (ncbitaxon:10090) | - | PubMed (19425150) | Source: BioModels - MODEL1507180067 |
| Roles Classification |
|---|
| Biological Roles: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). Saccharomyces cerevisiae metabolite Any fungal metabolite produced during a metabolic reaction in Baker's yeast (Saccharomyces cerevisiae ). Escherichia coli metabolite Any bacterial metabolite produced during a metabolic reaction in Escherichia coli. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3',5'-cyclic GMP (CHEBI:16356) has role Escherichia coli metabolite (CHEBI:76971) |
| 3',5'-cyclic GMP (CHEBI:16356) has role Saccharomyces cerevisiae metabolite (CHEBI:75772) |
| 3',5'-cyclic GMP (CHEBI:16356) has role human metabolite (CHEBI:77746) |
| 3',5'-cyclic GMP (CHEBI:16356) has role mouse metabolite (CHEBI:75771) |
| 3',5'-cyclic GMP (CHEBI:16356) has role plant metabolite (CHEBI:76924) |
| 3',5'-cyclic GMP (CHEBI:16356) is a 3',5'-cyclic purine nucleotide (CHEBI:19834) |
| 3',5'-cyclic GMP (CHEBI:16356) is a guanyl ribonucleotide (CHEBI:61295) |
| 3',5'-cyclic GMP (CHEBI:16356) is conjugate acid of 3',5'-cyclic GMP(1−) (CHEBI:57746) |
| Incoming Relation(s) |
| (Rp)-cGMPS (CHEBI:84642) has functional parent 3',5'-cyclic GMP (CHEBI:16356) |
| (Sp)-8-Br-cGMPS (CHEBI:84641) has functional parent 3',5'-cyclic GMP (CHEBI:16356) |
| (Sp)-cGMPS (CHEBI:84640) has functional parent 3',5'-cyclic GMP (CHEBI:16356) |
| N1-methyl-cGMP (CHEBI:84632) has functional parent 3',5'-cyclic GMP (CHEBI:16356) |
| N2,N2-dimethyl-cGMP (CHEBI:84635) has functional parent 3',5'-cyclic GMP (CHEBI:16356) |
| N2,3-etheno-cGMP (CHEBI:84636) has functional parent 3',5'-cyclic GMP (CHEBI:16356) |
| 8-(4-chlorophenylthio)-cGMP (CHEBI:84638) has functional parent 3',5'-cyclic GMP (CHEBI:16356) |
| 8-(6-aminohexylthio)-cGMP (CHEBI:84639) has functional parent 3',5'-cyclic GMP (CHEBI:16356) |
| 8-bromo-3',5'-cyclic GMP (CHEBI:64108) has functional parent 3',5'-cyclic GMP (CHEBI:16356) |
| 8-nitroguanosine 3',5'-cyclic monophosphate (CHEBI:136665) has functional parent 3',5'-cyclic GMP (CHEBI:16356) |
| 3',5'-cyclic GMP(1−) (CHEBI:57746) is conjugate base of 3',5'-cyclic GMP (CHEBI:16356) |
| IUPAC Name |
|---|
| guanosine 3',5'-(hydrogen phosphate) |
| Synonyms | Source |
|---|---|
| 3',5'-Cyclic GMP | KEGG COMPOUND |
| cGMP | KEGG COMPOUND |
| Cyclic GMP | KEGG COMPOUND |
| Guanosine 3',5'-cyclic monophosphate | KEGG COMPOUND |
| Guanosine 3',5'-cyclic phosphate | KEGG COMPOUND |
| Guanosine cyclic monophosphate | ChemIDplus |
| Citations |
|---|