EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H11N6O9P |
| Net Charge | 0 |
| Average Mass | 390.205 |
| Monoisotopic Mass | 390.03251 |
| SMILES | Nc1nc(=O)c2nc([N+](=O)[O-])n([C@@H]3O[C@@H]4COP(=O)(O)O[C@H]4[C@H]3O)c2n1 |
| InChI | InChI=1S/C10H11N6O9P/c11-9-13-6-3(7(18)14-9)12-10(16(19)20)15(6)8-4(17)5-2(24-8)1-23-26(21,22)25-5/h2,4-5,8,17H,1H2,(H,21,22)(H3,11,13,14,18)/t2-,4-,5-,8-/m1/s1 |
| InChIKey | XRKODJJSPSPDGM-UMMCILCDSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Brassica napus (ncbitaxon:3708) | |||
| - | MetaboLights (MTBLS309) | ||
| - | PubMed (26641455) | ||
| Homo sapiens (ncbitaxon:9606) | - | PubMed (28109891) |
| Roles Classification |
|---|
| Biological Roles: | signalling molecule A molecular messenger in which the molecule is specifically involved in transmitting information between cells. Such molecules are released from the cell sending the signal, cross over the gap between cells by diffusion, and interact with specific receptors in another cell, triggering a response in that cell by activating a series of enzyme controlled reactions which lead to changes inside the cell. human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). Brassica napus metabolite Any plant metabolite that is produced by rapeseed (Brassica napus). |
| Application: | biomarker A substance used as an indicator of a biological state. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 8-nitroguanosine 3',5'-cyclic monophosphate (CHEBI:136665) has functional parent 3',5'-cyclic GMP (CHEBI:16356) |
| 8-nitroguanosine 3',5'-cyclic monophosphate (CHEBI:136665) has role Brassica napus metabolite (CHEBI:140165) |
| 8-nitroguanosine 3',5'-cyclic monophosphate (CHEBI:136665) has role biomarker (CHEBI:59163) |
| 8-nitroguanosine 3',5'-cyclic monophosphate (CHEBI:136665) has role human metabolite (CHEBI:77746) |
| 8-nitroguanosine 3',5'-cyclic monophosphate (CHEBI:136665) has role signalling molecule (CHEBI:62488) |
| 8-nitroguanosine 3',5'-cyclic monophosphate (CHEBI:136665) is a C-nitro compound (CHEBI:35716) |
| 8-nitroguanosine 3',5'-cyclic monophosphate (CHEBI:136665) is a 3',5'-cyclic purine nucleotide (CHEBI:19834) |
| 8-nitroguanosine 3',5'-cyclic monophosphate (CHEBI:136665) is conjugate acid of 8-nitroguanosine 3',5'-cyclic monophosphate(1−) (CHEBI:144462) |
| Incoming Relation(s) |
| 8-nitroguanosine 3',5'-cyclic monophosphate(1−) (CHEBI:144462) is conjugate base of 8-nitroguanosine 3',5'-cyclic monophosphate (CHEBI:136665) |
| Synonyms | Source |
|---|---|
| 8-nitro-cGMP | ChEBI |
| 8-nitroguanosine 3',5'-cyclic phosphate | ChEBI |
| 8-nitroguanosine 3',5'-(hydrogen phosphate) | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:15593276 | Reaxys |
| Citations |
|---|