EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H11BrN5O6PS |
| Net Charge | 0 |
| Average Mass | 440.172 |
| Monoisotopic Mass | 438.93510 |
| SMILES | Nc1nc(=O)c2nc(Br)n([C@@H]3O[C@@H]4CO[P@](=O)(S)O[C@H]4[C@H]3O)c2n1 |
| InChI | InChI=1S/C10H11BrN5O6PS/c11-9-13-3-6(14-10(12)15-7(3)18)16(9)8-4(17)5-2(21-8)1-20-23(19,24)22-5/h2,4-5,8,17H,1H2,(H,19,24)(H3,12,14,15,18)/t2-,4-,5-,8-,23+/m1/s1 |
| InChIKey | KRYIOQOBMVFLBO-JXGIQVKMSA-N |
| Roles Classification |
|---|
| Biological Role: | protein kinase agonist An agonist that selectively binds to and activates a protein kinase receptor. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (Sp)-8-Br-cGMPS (CHEBI:84641) has functional parent 3',5'-cyclic GMP (CHEBI:16356) |
| (Sp)-8-Br-cGMPS (CHEBI:84641) has role protein kinase agonist (CHEBI:64106) |
| (Sp)-8-Br-cGMPS (CHEBI:84641) is a nucleoside 3',5'-cyclic phosphorothioate (CHEBI:85287) |
| (Sp)-8-Br-cGMPS (CHEBI:84641) is a organobromine compound (CHEBI:37141) |
| (Sp)-8-Br-cGMPS (CHEBI:84641) is a purines (CHEBI:26401) |
| IUPAC Name |
|---|
| 2-amino-8-bromo-9-[(2S,4aR,6R,7R,7aS)-7-hydroxy-2-oxo-2-sulfanyltetrahydro-2H,4H-2λ5-furo[3,2-d][1,3,2]dioxaphosphinin-6-yl]-1,9-dihydro-6H-purin-6-one |
| Synonyms | Source |
|---|---|
| 8-bromo-Sp-cGMPS | ChEBI |
| Sp-8-Br-cGMPS | ChEBI |
| (Sp)-8-bromoguanosine-3',5'-cyclic monophosphorothioate | ChEBI |
| Citations |
|---|