EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H6O4 |
| Net Charge | 0 |
| Average Mass | 154.121 |
| Monoisotopic Mass | 154.02661 |
| SMILES | O=C(O)c1cc(O)ccc1O |
| InChI | InChI=1S/C7H6O4/c8-4-1-2-6(9)5(3-4)7(10)11/h1-3,8-9H,(H,10,11) |
| InChIKey | WXTMDXOMEHJXQO-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Mus musculus (ncbitaxon:10090) | - | PubMed (19425150) | Source: BioModels - MODEL1507180067 |
| Tremella fuciformis (ncbitaxon:64657) | - | PubMed (24547933) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). EC 1.13.11.33 (arachidonate 15-lipoxygenase) inhibitor A lipoxygenase inhibitor that interferes with the action of arachidonate 15-lipoxygenase (EC 1.13.11.33). fungal metabolite Any eukaryotic metabolite produced during a metabolic reaction in fungi, the kingdom that includes microorganisms such as the yeasts and moulds. human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| Application: | MALDI matrix material A compound used to form the matrix for MALDI (matrix-assisted laser desorption/ionization) mass spectrometry. MALDI matrix materials are crystalline compounds with a fairly low molecular weight, so as to allow facile vaporization, have strong absorption at UV or IR wavelengths (to rapidly and efficiently absorb laser irradiation), generally contain polar groups (enabling them to be used in aqueous solutions) and are frequently acidic (so assisting ionisation of the compound being studied, which is contained within the matrix material). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2,5-dihydroxybenzoic acid (CHEBI:17189) has functional parent benzoic acid (CHEBI:30746) |
| 2,5-dihydroxybenzoic acid (CHEBI:17189) has role EC 1.13.11.33 (arachidonate 15-lipoxygenase) inhibitor (CHEBI:64996) |
| 2,5-dihydroxybenzoic acid (CHEBI:17189) has role fungal metabolite (CHEBI:76946) |
| 2,5-dihydroxybenzoic acid (CHEBI:17189) has role human metabolite (CHEBI:77746) |
| 2,5-dihydroxybenzoic acid (CHEBI:17189) has role MALDI matrix material (CHEBI:64345) |
| 2,5-dihydroxybenzoic acid (CHEBI:17189) has role mouse metabolite (CHEBI:75771) |
| 2,5-dihydroxybenzoic acid (CHEBI:17189) is a dihydroxybenzoic acid (CHEBI:23778) |
| 2,5-dihydroxybenzoic acid (CHEBI:17189) is conjugate acid of 2,5-dihydroxybenzoate (CHEBI:58044) |
| Incoming Relation(s) |
| 2,5-dihydroxybenzoic acid 2-O-β-D-glucoside (CHEBI:136922) has functional parent 2,5-dihydroxybenzoic acid (CHEBI:17189) |
| 2,5-dihydroxybenzoic acid 5-O-β-D-glucoside (CHEBI:136772) has functional parent 2,5-dihydroxybenzoic acid (CHEBI:17189) |
| 2,5-dihydroxybenzoyl-CoA (CHEBI:90176) has functional parent 2,5-dihydroxybenzoic acid (CHEBI:17189) |
| benzyl 2,5-dihydroxybenzoate (CHEBI:155896) has functional parent 2,5-dihydroxybenzoic acid (CHEBI:17189) |
| mygalin (CHEBI:64901) has functional parent 2,5-dihydroxybenzoic acid (CHEBI:17189) |
| 2,5-dihydroxybenzoate (CHEBI:58044) is conjugate base of 2,5-dihydroxybenzoic acid (CHEBI:17189) |
| IUPAC Name |
|---|
| 2,5-dihydroxybenzoic acid |
| Synonyms | Source |
|---|---|
| 2,5-Dihydroxybenzoate | KEGG COMPOUND |
| 2,5-dihydroxybenzoic acid | ChEBI |
| 2,5-Dihydroxybenzoic acid | KEGG COMPOUND |
| 5-hydroxysalicylic acid | ChEBI |
| Gentisate | KEGG COMPOUND |
| Gentisic acid | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| 3260 | DrugCentral |
| C00002648 | KNApSAcK |
| C00628 | KEGG COMPOUND |
| CPD-633 | MetaCyc |
| Gentisic_acid | Wikipedia |
| GTQ | PDBeChem |
| HMDB0000152 | HMDB |
| LSM-19031 | LINCS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2209119 | Reaxys |
| CAS:490-79-9 | ChemIDplus |
| CAS:490-79-9 | KEGG COMPOUND |
| Citations |
|---|