EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H27N3O6 |
| Net Charge | 0 |
| Average Mass | 417.462 |
| Monoisotopic Mass | 417.18999 |
| SMILES | O=C(NCCCCNCCCNC(=O)c1cc(O)ccc1O)c1cc(O)ccc1O |
| InChI | InChI=1S/C21H27N3O6/c25-14-4-6-18(27)16(12-14)20(29)23-10-2-1-8-22-9-3-11-24-21(30)17-13-15(26)5-7-19(17)28/h4-7,12-13,22,25-28H,1-3,8-11H2,(H,23,29)(H,24,30) |
| InChIKey | LOUWELXLLQURSP-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| mygalin (CHEBI:64901) has functional parent 2,5-dihydroxybenzoic acid (CHEBI:17189) |
| mygalin (CHEBI:64901) has functional parent spermidine (CHEBI:16610) |
| mygalin (CHEBI:64901) has role antibacterial agent (CHEBI:33282) |
| mygalin (CHEBI:64901) is a benzamides (CHEBI:22702) |
| mygalin (CHEBI:64901) is a hydroquinones (CHEBI:24646) |
| IUPAC Name |
|---|
| N-[3-({4-[(2,5-dihydroxybenzoyl)amino]butyl}amino)propyl]-2,5-dihydroxybenzamide |
| Synonym | Source |
|---|---|
| N1,N8-bis(2,5-dihydroxybenzoyl)spermidine | ChEBI |
| Citations |
|---|