EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H12O4 |
| Net Charge | 0 |
| Average Mass | 244.246 |
| Monoisotopic Mass | 244.07356 |
| SMILES | O=C(OCc1ccccc1)c1cc(O)ccc1O |
| InChI | InChI=1S/C14H12O4/c15-11-6-7-13(16)12(8-11)14(17)18-9-10-4-2-1-3-5-10/h1-8,15-16H,9H2 |
| InChIKey | LRYANVPYFCKCCR-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Paeonia lactiflora (ncbitaxon:35924) | root (BTO:0001188) | PubMed (28901069) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| benzyl 2,5-dihydroxybenzoate (CHEBI:155896) has functional parent 2,5-dihydroxybenzoic acid (CHEBI:17189) |
| benzyl 2,5-dihydroxybenzoate (CHEBI:155896) has role plant metabolite (CHEBI:76924) |
| benzyl 2,5-dihydroxybenzoate (CHEBI:155896) is a benzoate ester (CHEBI:36054) |
| benzyl 2,5-dihydroxybenzoate (CHEBI:155896) is a benzyl ester (CHEBI:90628) |
| benzyl 2,5-dihydroxybenzoate (CHEBI:155896) is a phenols (CHEBI:33853) |
| IUPAC Name |
|---|
| benzyl 2,5-dihydroxybenzoate |
| Synonyms | Source |
|---|---|
| 2,5-dihydroxybenzoic acid benzyl ester | ChEBI |
| benzyl gentisate | ChEBI |
| phenylmethyl 2,5-dihydroxybenzoate | ChEBI |
| trichocarpigenin | ChEBI |
| trichocarpinene | ChEBI |
| Registry Numbers | Sources |
|---|---|
| CAS:21782-87-6 | ChEBI |
| Citations |
|---|