EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C28H40N7O19P3S |
| Net Charge | 0 |
| Average Mass | 903.647 |
| Monoisotopic Mass | 903.13125 |
| SMILES | CC(C)(COP(=O)(O)OP(=O)(O)OC[C@H]1O[C@@H](n2cnc3c(N)ncnc32)[C@H](O)[C@@H]1OP(=O)(O)O)[C@@H](O)C(=O)NCCC(=O)NCCSC(=O)c1cc(O)ccc1O |
| InChI | InChI=1S/C28H40N7O19P3S/c1-28(2,22(40)25(41)31-6-5-18(38)30-7-8-58-27(42)15-9-14(36)3-4-16(15)37)11-51-57(48,49)54-56(46,47)50-10-17-21(53-55(43,44)45)20(39)26(52-17)35-13-34-19-23(29)32-12-33-24(19)35/h3-4,9,12-13,17,20-22,26,36-37,39-40H,5-8,10-11H2,1-2H3,(H,30,38)(H,31,41)(H,46,47)(H,48,49)(H2,29,32,33)(H2,43,44,45)/t17-,20-,21-,22+,26-/m1/s1 |
| InChIKey | JWFTZSFRBMKSNJ-TYHXJLICSA-N |
| Roles Classification |
|---|
| Chemical Role: | acyl donor Any donor that can transfer acyl groups between molecular entities. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2,5-dihydroxybenzoyl-CoA (CHEBI:90176) has functional parent 2,5-dihydroxybenzoic acid (CHEBI:17189) |
| 2,5-dihydroxybenzoyl-CoA (CHEBI:90176) is a acyl-CoA (CHEBI:17984) |
| 2,5-dihydroxybenzoyl-CoA (CHEBI:90176) is conjugate acid of 2,5-dihydroxybenzoyl-CoA(4−) (CHEBI:88147) |
| Incoming Relation(s) |
| 2,5-dihydroxybenzoyl-CoA(4−) (CHEBI:88147) is conjugate base of 2,5-dihydroxybenzoyl-CoA (CHEBI:90176) |
| IUPAC Name |
|---|
| 3'-phosphoadenosine 5'-{3-[(3R)-4-{[3-({2-[(2,5-dihydroxybenzoyl)sulfanyl]ethyl}amino)-3-oxopropyl]amino}-3-hydroxy-2,2-dimethyl-4-oxobutyl] dihydrogen diphosphate} |
| Synonym | Source |
|---|---|
| gentisyl-CoA | MetaCyc |
| Manual Xrefs | Databases |
|---|---|
| CPD-12703 | MetaCyc |
| Registry Numbers | Sources |
|---|---|
| Reaxys:22360399 | Reaxys |