EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H14N2O5S |
| Net Charge | 0 |
| Average Mass | 250.276 |
| Monoisotopic Mass | 250.06234 |
| SMILES | N[C@@H](CCC(=O)N[C@@H](CS)C(=O)O)C(=O)O |
| InChI | InChI=1S/C8H14N2O5S/c9-4(7(12)13)1-2-6(11)10-5(3-16)8(14)15/h4-5,16H,1-3,9H2,(H,10,11)(H,12,13)(H,14,15)/t4-,5-/m0/s1 |
| InChIKey | RITKHVBHSGLULN-WHFBIAKZSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Escherichia coli (ncbitaxon:562) | - | PubMed (21988831) | |
| Mus musculus (ncbitaxon:10090) | - | PubMed (19425150) | Source: BioModels - MODEL1507180067 |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | Saccharomyces cerevisiae metabolite Any fungal metabolite produced during a metabolic reaction in Baker's yeast (Saccharomyces cerevisiae ). Escherichia coli metabolite Any bacterial metabolite produced during a metabolic reaction in Escherichia coli. mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| L-γ-glutamyl-L-cysteine (CHEBI:17515) has functional parent L-cysteine (CHEBI:17561) |
| L-γ-glutamyl-L-cysteine (CHEBI:17515) has functional parent L-glutamic acid (CHEBI:16015) |
| L-γ-glutamyl-L-cysteine (CHEBI:17515) has role Escherichia coli metabolite (CHEBI:76971) |
| L-γ-glutamyl-L-cysteine (CHEBI:17515) has role Saccharomyces cerevisiae metabolite (CHEBI:75772) |
| L-γ-glutamyl-L-cysteine (CHEBI:17515) has role human metabolite (CHEBI:77746) |
| L-γ-glutamyl-L-cysteine (CHEBI:17515) has role mouse metabolite (CHEBI:75771) |
| L-γ-glutamyl-L-cysteine (CHEBI:17515) is a gamma-glutamylcysteine (CHEBI:24195) |
| L-γ-glutamyl-L-cysteine (CHEBI:17515) is conjugate acid of L-γ-glutamyl-L-cysteinate(1−) (CHEBI:58173) |
| Incoming Relation(s) |
| DON-10-gamma-glutamylcysteine (CHEBI:149450) has functional parent L-γ-glutamyl-L-cysteine (CHEBI:17515) |
| L-γ-glutamyl-L-cysteinate(1−) (CHEBI:58173) is conjugate base of L-γ-glutamyl-L-cysteine (CHEBI:17515) |
| IUPAC Name |
|---|
| L-γ-glutamyl-L-cysteine |
| Synonyms | Source |
|---|---|
| 5-L-Glutamyl-L-cysteine | KEGG COMPOUND |
| gamma-Glu-Cys | ChEBI |
| gamma-Glutamylcysteine | KEGG COMPOUND |
| gamma-L-Glutamyl-L-cysteine | KEGG COMPOUND |
| Glu(-Cys) | JCBN |
| L-gamma-Glutamylcysteine | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C00007507 | KNApSAcK |
| C00669 | KEGG COMPOUND |
| DB03408 | DrugBank |
| Gamma-Glutamylcysteine | Wikipedia |
| HMDB0001049 | HMDB |
| L-GAMMA-GLUTAMYLCYSTEINE | MetaCyc |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1729154 | Reaxys |
| CAS:636-58-8 | ChemIDplus |
| CAS:636-58-8 | KEGG COMPOUND |
| Citations |
|---|