EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H13N2O5S |
| Net Charge | -1 |
| Average Mass | 249.268 |
| Monoisotopic Mass | 249.05507 |
| SMILES | [NH3+][C@@H](CCC(=O)N[C@@H](CS)C(=O)[O-])C(=O)[O-] |
| InChI | InChI=1S/C8H14N2O5S/c9-4(7(12)13)1-2-6(11)10-5(3-16)8(14)15/h4-5,16H,1-3,9H2,(H,10,11)(H,12,13)(H,14,15)/p-1/t4-,5-/m0/s1 |
| InChIKey | RITKHVBHSGLULN-WHFBIAKZSA-M |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | - | DOI (10.1038/nbt.2488) | |
| Saccharomyces cerevisiae (ncbitaxon:4932) | - | PubMed (24678285) | Source: yeast.sf.net |
| Roles Classification |
|---|
| Biological Roles: | Saccharomyces cerevisiae metabolite Any fungal metabolite produced during a metabolic reaction in Baker's yeast (Saccharomyces cerevisiae ). human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| L-γ-glutamyl-L-cysteinate(1−) (CHEBI:58173) has role Saccharomyces cerevisiae metabolite (CHEBI:75772) |
| L-γ-glutamyl-L-cysteinate(1−) (CHEBI:58173) has role human metabolite (CHEBI:77746) |
| L-γ-glutamyl-L-cysteinate(1−) (CHEBI:58173) is a peptide anion (CHEBI:60334) |
| L-γ-glutamyl-L-cysteinate(1−) (CHEBI:58173) is conjugate base of L-γ-glutamyl-L-cysteine (CHEBI:17515) |
| Incoming Relation(s) |
| L-γ-glutamyl-L-cysteine (CHEBI:17515) is conjugate acid of L-γ-glutamyl-L-cysteinate(1−) (CHEBI:58173) |
| IUPAC Name |
|---|
| (2S)-2-azaniumyl-5-{[(1R)-1-carboxylato-2-sulfanylethyl]amino}-5-oxopentanoate |
| Synonyms | Source |
|---|---|
| L-γ-glutamyl-L-cysteinate | ChEBI |
| L-γ-glutamyl-L-cysteinate anion | ChEBI |
| UniProt Name | Source |
|---|---|
| γ-L-glutamyl-L-cysteine | UniProt |