EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H13N3O3S |
| Net Charge | 0 |
| Average Mass | 267.310 |
| Monoisotopic Mass | 267.06776 |
| SMILES | Cc1noc(NS(=O)(=O)c2ccc(N)cc2)c1C |
| InChI | InChI=1S/C11H13N3O3S/c1-7-8(2)13-17-11(7)14-18(15,16)10-5-3-9(12)4-6-10/h3-6,14H,12H2,1-2H3 |
| InChIKey | NHUHCSRWZMLRLA-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. drug allergen Any drug which causes the onset of an allergic reaction. antibacterial drug A drug used to treat or prevent bacterial infections. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| Applications: | ophthalmology drug Any compound used for the treatment of eye conditions or eye diseases. drug allergen Any drug which causes the onset of an allergic reaction. antibacterial drug A drug used to treat or prevent bacterial infections. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| sulfisoxazole (CHEBI:102484) has functional parent sulfanilamide (CHEBI:45373) |
| sulfisoxazole (CHEBI:102484) has role antibacterial agent (CHEBI:33282) |
| sulfisoxazole (CHEBI:102484) has role antibacterial drug (CHEBI:36047) |
| sulfisoxazole (CHEBI:102484) has role drug allergen (CHEBI:88188) |
| sulfisoxazole (CHEBI:102484) has role ophthalmology drug (CHEBI:66981) |
| sulfisoxazole (CHEBI:102484) is a isoxazoles (CHEBI:55373) |
| sulfisoxazole (CHEBI:102484) is a sulfonamide (CHEBI:35358) |
| sulfisoxazole (CHEBI:102484) is a sulfonamide antibiotic (CHEBI:87228) |
| Incoming Relation(s) |
| sulfisoxazole diolamine (CHEBI:88263) has part sulfisoxazole (CHEBI:102484) |
| IUPAC Name |
|---|
| 4-amino-N-(3,4-dimethylisoxazol-5-yl)benzenesulfonamide |
| INNs | Source |
|---|---|
| sulfafurazole | KEGG DRUG |
| sulfafurazolum | ChemIDplus |
| Synonyms | Source |
|---|---|
| 3,4-Dimethyl-5-sulfanilamidoisoxazole | ChemIDplus |
| 3,4-Dimethyl-5-sulfonamidoisoxazole | ChemIDplus |
| 3,4-Dimethyl-5-sulphanilamidoisoxazole | ChemIDplus |
| 3,4-Dimethyl-5-sulphonamidoisoxazole | ChemIDplus |
| 3,4-Dimethylisoxazole-5-sulfanilamide | ChemIDplus |
| 3,4-Dimethylisoxazole-5-sulphanilamide | ChemIDplus |
| Brand Names | Source |
|---|---|
| Entusil | ChEMBL |
| Neazolin | ChEMBL |
| Sosol | ChEMBL |
| Soxazole | ChEMBL |
| Sulfalar | ChEMBL |
| Sulfisoxazole component of azo gantrisin | ChEMBL |
| Citations |
|---|