EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H13N3O3S.C4H11NO2 |
| Net Charge | 0 |
| Average Mass | 372.447 |
| Monoisotopic Mass | 372.14674 |
| SMILES | Cc1noc(NS(=O)(=O)c2ccc(N)cc2)c1C.OCCNCCO |
| InChI | InChI=1S/C11H13N3O3S.C4H11NO2/c1-7-8(2)13-17-11(7)14-18(15,16)10-5-3-9(12)4-6-10;6-3-1-5-2-4-7/h3-6,14H,12H2,1-2H3;5-7H,1-4H2 |
| InChIKey | FEPTXVIRMZIGFY-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Bacillus methanolicus MGA3 (ncbitaxon:796606) | |||
| - | MetaboLights (MTBLS228) | ||
| - | PubMed (26366644) |
| Roles Classification |
|---|
| Biological Role: | antibacterial drug A drug used to treat or prevent bacterial infections. |
| Application: | antibacterial drug A drug used to treat or prevent bacterial infections. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| sulfisoxazole diolamine (CHEBI:88263) has part sulfisoxazole (CHEBI:102484) |
| sulfisoxazole diolamine (CHEBI:88263) has role antibacterial drug (CHEBI:36047) |
| sulfisoxazole diolamine (CHEBI:88263) is a organoammonium salt (CHEBI:46850) |
| IUPAC Name |
|---|
| 4-amino-N-(3,4-dimethyl-1,2-oxazol-5-yl)benzene-1-sulfonamide--2,2'-azanediyldi(ethan-1-ol) (1/1) |
| Synonyms | Source |
|---|---|
| sulfisoxazole diethanolamine | ChEBI |
| Sulfafurazole diolamine | KEGG DRUG |
| Sulfafurazol 2,2'-imidodiethanol | ChemIDplus |
| Citations |
|---|