EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H14N4O2S |
| Net Charge | 0 |
| Average Mass | 278.337 |
| Monoisotopic Mass | 278.08375 |
| SMILES | Cc1cc(C)nc(NS(=O)(=O)c2ccc(N)cc2)n1 |
| InChI | InChI=1S/C12H14N4O2S/c1-8-7-9(2)15-12(14-8)16-19(17,18)11-5-3-10(13)4-6-11/h3-7H,13H2,1-2H3,(H,14,15,16) |
| InChIKey | ASWVTGNCAZCNNR-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Roles: | ligand Any molecule or ion capable of binding to a central metal atom to form coordination complexes. environmental contaminant Any minor or unwanted substance introduced into the environment that can have undesired effects. |
| Biological Roles: | xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. antibacterial drug A drug used to treat or prevent bacterial infections. drug allergen Any drug which causes the onset of an allergic reaction. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. carcinogenic agent A role played by a chemical compound which is known to induce a process of carcinogenesis by corrupting normal cellular pathways, leading to the acquistion of tumoral capabilities. EC 2.5.1.15 (dihydropteroate synthase) inhibitor An EC 2.5.1.* (non-methyl-alkyl or aryl transferase) inhibitor that interferes with the action of dihydropteroate synthase (EC 2.5.1.15), an enzyme that catalyzes the formation of dihydropteroate from p-aminobenzoic acid and dihydropteridine-hydroxymethyl-pyrophosphate. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| Applications: | antibacterial drug A drug used to treat or prevent bacterial infections. drug allergen Any drug which causes the onset of an allergic reaction. antiinfective agent A substance used in the prophylaxis or therapy of infectious diseases. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| sulfamethazine (CHEBI:102265) has functional parent sulfanilamide (CHEBI:45373) |
| sulfamethazine (CHEBI:102265) has role antibacterial drug (CHEBI:36047) |
| sulfamethazine (CHEBI:102265) has role antiinfective agent (CHEBI:35441) |
| sulfamethazine (CHEBI:102265) has role antimicrobial agent (CHEBI:33281) |
| sulfamethazine (CHEBI:102265) has role carcinogenic agent (CHEBI:50903) |
| sulfamethazine (CHEBI:102265) has role drug allergen (CHEBI:88188) |
| sulfamethazine (CHEBI:102265) has role EC 2.5.1.15 (dihydropteroate synthase) inhibitor (CHEBI:50502) |
| sulfamethazine (CHEBI:102265) has role environmental contaminant (CHEBI:78298) |
| sulfamethazine (CHEBI:102265) has role ligand (CHEBI:52214) |
| sulfamethazine (CHEBI:102265) has role xenobiotic (CHEBI:35703) |
| sulfamethazine (CHEBI:102265) is a pyrimidines (CHEBI:39447) |
| sulfamethazine (CHEBI:102265) is a sulfonamide (CHEBI:35358) |
| sulfamethazine (CHEBI:102265) is a sulfonamide antibiotic (CHEBI:87228) |
| Incoming Relation(s) |
| sulfabromomethazine (CHEBI:145405) has functional parent sulfamethazine (CHEBI:102265) |
| IUPAC Name |
|---|
| 4-amino-N-(4,6-dimethylpyrimidin-2-yl)benzenesulfonamide |
| INNs | Source |
|---|---|
| sulfadimidina | ChemIDplus |
| sulfadimidine | KEGG DRUG |
| sulfadimidinum | ChemIDplus |
| Synonyms | Source |
|---|---|
| 2-(4-Aminobenzenesulfonamido)-4,6-dimethylpyrimidine | NIST Chemistry WebBook |
| 2-(p-Aminobenzenesulfonamido)-4,6-dimethylpyrimidine | ChemIDplus |
| 2-Sulfanilamido-4,6-dimethylpyrimidine | ChemIDplus |
| 4,6-Dimethyl-2-sulfanilamidopyrimidine | ChemIDplus |
| 4-Amino-N-(2,6-dimethyl-4-pyrimidinyl)benzenesulfonamide | ChemIDplus |
| 4-amino-N-(4,6-dimethylpyrimidin-2-yl)benzenesulfonamide | ChEMBL |
| Manual Xrefs | Databases |
|---|---|
| 1829 | VSDB |
| 2502 | DrugCentral |
| C19530 | KEGG COMPOUND |
| D02436 | KEGG DRUG |
| DB01582 | DrugBank |
| EP1861101 | Patent |
| GB546158 | Patent |
| GB552887 | Patent |
| HMDB0015522 | HMDB |
| LSM-5295 | LINCS |
| Sulfadimidine | Wikipedia |
| US2407966 | Patent |
| US3119818 | Patent |
| WO2005016386 | Patent |
| Citations |
|---|