EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H13BrN4O2S |
| Net Charge | 0 |
| Average Mass | 357.233 |
| Monoisotopic Mass | 355.99426 |
| SMILES | Cc1nc(NS(=O)(=O)c2ccc(N)cc2)nc(C)c1Br |
| InChI | InChI=1S/C12H13BrN4O2S/c1-7-11(13)8(2)16-12(15-7)17-20(18,19)10-5-3-9(14)4-6-10/h3-6H,14H2,1-2H3,(H,15,16,17) |
| InChIKey | KWXCNODTHBHSIQ-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| sulfabromomethazine (CHEBI:145405) has functional parent sulfamethazine (CHEBI:102265) |
| sulfabromomethazine (CHEBI:145405) has role antibacterial agent (CHEBI:33282) |
| sulfabromomethazine (CHEBI:145405) is a sulfonamide (CHEBI:35358) |
| IUPAC Names |
|---|
| 4-amino-N-(5-bromo-4,6-dimethylpyrimidin-2-yl)benzene-1-sulfonamide |
| 4-amino-N-(5-bromo-4,6-dimethylpyrimidin-2-yl)benzenesulfonamide |
| Synonyms | Source |
|---|---|
| 4-amino-N-(5-bromo-4,6-dimethyl-2-pyrimidinyl)benzenesulfonamide | ChemIDplus |
| 5-bromosulfamethazine | ChemIDplus |
| N1-(5-bromo-4,6-dimethyl-2-pyrimidinyl)sulfanilamide | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| CAS:116-45-0 | ChemIDplus |
| Citations |
|---|