EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H9NO5 |
| Net Charge | 0 |
| Average Mass | 175.140 |
| Monoisotopic Mass | 175.04807 |
| SMILES | COC(=O)CNC(=O)C(=O)OC |
| InChI | InChI=1S/C6H9NO5/c1-11-4(8)3-7-5(9)6(10)12-2/h3H2,1-2H3,(H,7,9) |
| InChIKey | BNJOZDZCRHCODO-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | EC 1.14.11.29 (hypoxia-inducible factor-proline dioxygenase) inhibitor An EC 1.14.11.* (oxidoreductase acting on paired donors, 2-oxoglutarate as one donor, incorporating 1 atom each of oxygen into both donors) inhibitor that interferes with the action of hypoxia-inducible factor-proline dioxygenase (EC 1.14.11.29). |
| Application: | neuroprotective agent Any compound that can be used for the treatment of neurodegenerative disorders. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| dimethyloxalylglycine (CHEBI:102218) has functional parent N-oxalylglycine (CHEBI:44482) |
| dimethyloxalylglycine (CHEBI:102218) has role EC 1.14.11.29 (hypoxia-inducible factor-proline dioxygenase) inhibitor (CHEBI:102248) |
| dimethyloxalylglycine (CHEBI:102218) has role neuroprotective agent (CHEBI:63726) |
| dimethyloxalylglycine (CHEBI:102218) is a glycine derivative (CHEBI:24373) |
| dimethyloxalylglycine (CHEBI:102218) is a methyl ester (CHEBI:25248) |
| dimethyloxalylglycine (CHEBI:102218) is a secondary carboxamide (CHEBI:140325) |
| IUPAC Name |
|---|
| methyl N-[methoxy(oxo)acetyl]glycinate |
| Synonyms | Source |
|---|---|
| DMOG | ChEBI |
| N-(2-methoxy-2-oxoacetyl)glycine methyl ester | ChEBI |
| N-oxalylglycine dimethyl ester | ChEBI |
| methyl N-(2-methoxy-2-oxoacetyl)glycinate | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2096268 | Reaxys |
| Citations |
|---|