EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C4H5NO5 |
| Net Charge | 0 |
| Average Mass | 147.086 |
| Monoisotopic Mass | 147.01677 |
| SMILES | O=C(O)CNC(=O)C(=O)O |
| InChI | InChI=1S/C4H5NO5/c6-2(7)1-5-3(8)4(9)10/h1H2,(H,5,8)(H,6,7)(H,9,10) |
| InChIKey | BIMZLRFONYSTPT-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | EC 1.14.11.* (oxidoreductase acting on paired donors, 2-oxoglutarate as one donor, incorporating 1 atom each of oxygen into both donors) inhibitor An EC 1.14.* (oxidoreductase acting on paired donors, with incorporation or reduction of molecular oxygen) inhibitor that interferes with the function of any such enzyme using 2-oxoglutarate as one donor and incorporating one atom each of oxygen into both donors (EC 1.14.11.*). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N-oxalylglycine (CHEBI:44482) has role EC 1.14.11.* (oxidoreductase acting on paired donors, 2-oxoglutarate as one donor, incorporating 1 atom each of oxygen into both donors) inhibitor (CHEBI:76902) |
| N-oxalylglycine (CHEBI:44482) is a N-acylglycine (CHEBI:16180) |
| N-oxalylglycine (CHEBI:44482) is a amino dicarboxylic acid (CHEBI:36164) |
| Incoming Relation(s) |
| dimethyloxalylglycine (CHEBI:102218) has functional parent N-oxalylglycine (CHEBI:44482) |
| IUPAC Name |
|---|
| N-(carboxycarbonyl)glycine |
| Synonyms | Source |
|---|---|
| 2-oxo-3-azaglutaric acid | ChEBI |
| NOG | ChEBI |
| Oxaloglycine | ChemIDplus |
| oxalylglycine | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| N-Oxalylglycine | Wikipedia |
| OGA | PDBeChem |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1771016 | Reaxys |
| CAS:5262-39-5 | ChemIDplus |
| Citations |
|---|