EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H7NO4 |
| Net Charge | 0 |
| Average Mass | 205.169 |
| Monoisotopic Mass | 205.03751 |
| SMILES | O=C(O)c1cc(O)c2cccc(O)c2n1 |
| InChI | InChI=1S/C10H7NO4/c12-7-3-1-2-5-8(13)4-6(10(14)15)11-9(5)7/h1-4,12H,(H,11,13)(H,14,15) |
| InChIKey | FBZONXHGGPHHIY-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Aedes aegypti (ncbitaxon:7159) | - | PubMed (22701629) |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | metabotropic glutamate receptor agonist An agonist that selectively binds to and activates a metabotropic glutamate receptor. animal metabolite Any eukaryotic metabolite produced during a metabolic reaction in animals that include diverse creatures from sponges, insects to mammals. vesicular glutamate transport inhibitor An inhibitor that interferes with vesicular glutamate transport. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| xanthurenic acid (CHEBI:10072) has role animal metabolite (CHEBI:75767) |
| xanthurenic acid (CHEBI:10072) has role iron chelator (CHEBI:38157) |
| xanthurenic acid (CHEBI:10072) has role metabotropic glutamate receptor agonist (CHEBI:61966) |
| xanthurenic acid (CHEBI:10072) has role vesicular glutamate transport inhibitor (CHEBI:72483) |
| xanthurenic acid (CHEBI:10072) is a dihydroxyquinoline (CHEBI:26507) |
| xanthurenic acid (CHEBI:10072) is a quinolinemonocarboxylic acid (CHEBI:26512) |
| xanthurenic acid (CHEBI:10072) is conjugate acid of xanthurenate (CHEBI:71201) |
| Incoming Relation(s) |
| quinolobactin (CHEBI:171659) has functional parent xanthurenic acid (CHEBI:10072) |
| xanthurenate (CHEBI:71201) is conjugate base of xanthurenic acid (CHEBI:10072) |
| IUPAC Name |
|---|
| 4,8-dihydroxyquinoline-2-carboxylic acid |
| Manual Xrefs | Databases |
|---|---|
| HMDB0000881 | HMDB |
| XANTHURENATE | MetaCyc |
| Xanthurenic_acid | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:185954 | Reaxys |
| CAS:59-00-7 | ChemIDplus |
| Citations |
|---|