EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H6NO4 |
| Net Charge | -1 |
| Average Mass | 204.161 |
| Monoisotopic Mass | 204.03023 |
| SMILES | O=C([O-])c1cc(O)c2cccc(O)c2n1 |
| InChI | InChI=1S/C10H7NO4/c12-7-3-1-2-5-8(13)4-6(10(14)15)11-9(5)7/h1-4,12H,(H,11,13)(H,14,15)/p-1 |
| InChIKey | FBZONXHGGPHHIY-UHFFFAOYSA-M |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Role: | animal metabolite Any eukaryotic metabolite produced during a metabolic reaction in animals that include diverse creatures from sponges, insects to mammals. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| xanthurenate (CHEBI:71201) has role animal metabolite (CHEBI:75767) |
| xanthurenate (CHEBI:71201) is a quinolinemonocarboxylate (CHEBI:38773) |
| xanthurenate (CHEBI:71201) is conjugate base of xanthurenic acid (CHEBI:10072) |
| Incoming Relation(s) |
| xanthurenic acid (CHEBI:10072) is conjugate acid of xanthurenate (CHEBI:71201) |
| IUPAC Name |
|---|
| 4,8-dihydroxyquinoline-2-carboxylate |
| UniProt Name | Source |
|---|---|
| xanthurenate | UniProt |
| Manual Xrefs | Databases |
|---|---|
| HMDB0000881 | HMDB |
| C02470 | KEGG COMPOUND |
| XANTHURENATE | MetaCyc |
| Xanthurenic_acid | Wikipedia |
| Citations |
|---|