EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H9NO4 |
| Net Charge | 0 |
| Average Mass | 219.196 |
| Monoisotopic Mass | 219.05316 |
| SMILES | COc1cc(C(=O)O)nc2c(O)cccc12 |
| InChI | InChI=1S/C11H9NO4/c1-16-9-5-7(11(14)15)12-10-6(9)3-2-4-8(10)13/h2-5,13H,1H3,(H,14,15) |
| InChIKey | BBZLFYDYFRWHEF-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Pseudomonas fluorescens (ncbitaxon:294) | - | PubMed (10653708 ) | GenBank: AY271621.1 Strain: ATCC 17400 |
| Roles Classification |
|---|
| Chemical Roles: | siderophore Any of low-molecular-mass iron(III)-chelating compounds produced by microorganisms for the purpose of the transport and sequestration of iron. Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. siderophore Any of low-molecular-mass iron(III)-chelating compounds produced by microorganisms for the purpose of the transport and sequestration of iron. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| quinolobactin (CHEBI:171659) has functional parent xanthurenic acid (CHEBI:10072) |
| quinolobactin (CHEBI:171659) has role bacterial metabolite (CHEBI:76969) |
| quinolobactin (CHEBI:171659) has role siderophore (CHEBI:26672) |
| quinolobactin (CHEBI:171659) is a aromatic ether (CHEBI:35618) |
| quinolobactin (CHEBI:171659) is a monohydroxyquinoline (CHEBI:38775) |
| quinolobactin (CHEBI:171659) is a phenols (CHEBI:33853) |
| quinolobactin (CHEBI:171659) is a quinolinemonocarboxylic acid (CHEBI:26512) |
| IUPAC Name |
|---|
| 8-hydroxy-4-methoxyquinoline-2-carboxylic acid |
| Synonyms | Source |
|---|---|
| 4-methoxy-8-hydroxyquinoline-2-carboxylic acid | ChEBI |
| 8-hydroxy-4-methoxy-quinaldic acid | ChEBI |
| 8-hydroxy-4-methoxyquinaldic acid | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| C00026479 | KNApSAcK |
| Registry Numbers | Sources |
|---|---|
| CAS:28027-14-7 | KNApSAcK |
| Citations |
|---|