EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:10043 - wogonin
| Formula | C16H12O5 |
| Net Charge | 0 |
| Average Mass | 284.267 |
| Monoisotopic Mass | 284.06847 |
| SMILES | COc1c(O)cc(O)c2c(=O)cc(-c3ccccc3)oc12 |
| InChI | InChI=1S/C16H12O5/c1-20-15-12(19)7-10(17)14-11(18)8-13(21-16(14)15)9-5-3-2-4-6-9/h2-8,17,19H,1H3 |
| InChIKey | XLTFNNCXVBYBSX-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | cyclooxygenase 2 inhibitor A cyclooxygenase inhibitor that interferes with the action of cyclooxygenase 2. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| Applications: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. angiogenesis inhibitor An agent and endogenous substances that antagonize or inhibit the development of new blood vessels. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| wogonin (CHEBI:10043) has role angiogenesis inhibitor (CHEBI:48422) |
| wogonin (CHEBI:10043) has role antineoplastic agent (CHEBI:35610) |
| wogonin (CHEBI:10043) has role cyclooxygenase 2 inhibitor (CHEBI:50629) |
| wogonin (CHEBI:10043) has role plant metabolite (CHEBI:76924) |
| wogonin (CHEBI:10043) is a dihydroxyflavone (CHEBI:38686) |
| wogonin (CHEBI:10043) is a monomethoxyflavone (CHEBI:25401) |
| wogonin (CHEBI:10043) is conjugate acid of wogonin(1−) (CHEBI:78338) |
| Incoming Relation(s) |
| wogonin 7-O-β-D-glucuronide (CHEBI:61282) has functional parent wogonin (CHEBI:10043) |
| wogonin(1−) (CHEBI:78338) is conjugate base of wogonin (CHEBI:10043) |
| IUPAC Name |
|---|
| 5,7-dihydroxy-8-methoxy-2-phenyl-4H-chromen-4-one |
| Synonyms | Source |
|---|---|
| Wogonin | KEGG COMPOUND |
| Norwogonin 8-methyl ether | KEGG COMPOUND |
| 5,7-Dihydroxy-8-methoxyflavone | ChemIDplus |
| 5,7-dihydroxy-8-methoxy-2-phenyl-4H-1-benzopyran-4-one | ChemIDplus |
| Citations |
|---|